CAS 1172133-28-6

HO-3867

Description:

HO-3867, with the CAS number 1172133-28-6, is a chemical compound that has garnered interest in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized by its specific molecular structure, which includes functional groups that may contribute to its biological activity. The compound is often studied for its role in modulating various biochemical pathways, potentially influencing processes such as inflammation or cellular signaling. Its solubility, stability, and reactivity are important factors that determine its efficacy and safety in biological systems. Additionally, HO-3867 may exhibit unique pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in living organisms. Research into this compound is ongoing, with studies aimed at elucidating its mechanism of action and potential applications in treating specific diseases or conditions. As with any chemical substance, understanding its characteristics is crucial for developing safe and effective therapeutic strategies.

Formula: C28H30F2N2O2

InChI: InChI=1S/C28H30F2N2O2/c1-27(2)15-23(28(3,4)32(27)34)18-31-16-21(13-19-5-9-24(29)10-6-19)26(33)22(17-31)14-20-7-11-25(30)12-8-20/h5-15,34H,16-18H2,1-4H3/b21-13+,22-14+

InChI key: PWZQFTQMMAIRRM-JFMUQQRKSA-N

SMILES: CC1(N(C(C(=C1)CN2C/C(=C\C3=CC=C(C=C3)F)/C(=O)/C(=C/C4=CC=C(C=C4)F)/C2)(C)C)O)C

HO-3867

CAS: 1172133-28-6

Formula: C₂₈H₃₀F₂N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 464.5468

Ref: IN-DA008TP1

HO-3867

CAS: 1172133-28-6

HO-3867

Formula: C₂₈H₃₀F₂N₂O₂

Purity: ≥90%

Molecular weight: 464.55

Ref: 54-BUP07534

HO-3867

CAS: 1172133-28-6

HO-3867, an analog of curcumin, is a sspecific STAT3 inhibitor.

Formula: C₂₈H₃₀F₂N₂O₂

Purity: 91.18% - 99.21%

Color and Shape: Solid

Molecular weight: 464.5468

Ref: TM-T6537

HO-3867

CAS: 1172133-28-6

(3E,5E)-1-[(2,5-Dihydro-1-hydroxy-2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]-3,5-bis[(4-fluorophenyl)methylene]-4-piperidinone

Formula: C₂₈H₃₀F₂N₂O₂

Purity: 97%

Molecular weight: 464.55

Ref: IN-DG764646

HO-3867

CAS: 1172133-28-6

HO-3867 is a synthetic small molecule, which is a derivative of curcumin, designed to enhance its therapeutic potential. Curcumin, a natural compound found in turmeric, is known for its anti-inflammatory and anticancer properties; however, its application is limited due to poor bioavailability and rapid systemic elimination. HO-3867 is engineered to overcome these limitations with structural modifications, improving its stability and bioavailability.

Formula: C₂₈H₃₀F₂N₂O₂

Purity: Min. 95%

Molecular weight: 464.55 g/mol

Ref: 3D-XWB13328