![1a,10b-Dihydro-1a,10b-d<sub>2</sub>-6H-dibenz[b,f]oxireno[d]azepine-2,3,4,5,7,8,9,10-d<sub>8</sub>…](https://static.cymitquimica.com/cas-image/thumb-webp/312794-carbamazepine-1011-epoxide-d10-rings-d10.webp)
CAS 1219804-16-6
:1a,10b-Dihydro-1a,10b-d<sub>2</sub>-6H-dibenz[b,f]oxireno[d]azepine-2,3,4,5,7,8,9,10-d<sub>8</sub>-6-carboxamide
Description:
1a,10b-Dihydro-1a,10b-d2-6H-dibenz[b,f]oxireno[d]azepine-2,3,4,5,7,8,9,10-d8-6-carboxamide is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a dibenzoxirene and azepine moiety. The presence of deuterium isotopes (d2 and d8) indicates that this compound has been isotopically labeled, which can be useful in various analytical applications, including tracing and metabolic studies. The carboxamide functional group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. This compound may exhibit specific pharmacological properties due to its structural features, which could influence its interaction with biological targets. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its applications could span medicinal chemistry, materials science, or analytical chemistry, depending on its properties and behavior in different environments. As with any chemical substance, safety and handling protocols should be observed, particularly due to the complexity of its structure and potential biological activity.
Formula:C15H12N2O2
InChI:InChI=1S/C15H12N2O2/c16-15(18)17-11-7-3-1-5-9(11)13-14(19-13)10-6-2-4-8-12(10)17/h1-8,13-14H,(H2,16,18)/i1D,2D,3D,4D,5D,6D,7D,8D,13D,14D
InChI key:InChIKey=ZRWWEEVEIOGMMT-WJSNEECMSA-N
SMILES:C(N)(=O)N1C=2C(C3(C(O3)(C=4C1=C(C(=C(C4[2H])[2H])[2H])[2H])[2H])[2H])=C(C(=C(C2[2H])[2H])[2H])[2H]
Synonyms:- 6H-Dibenz[b,f]oxireno[d]azepine-2,3,4,5,7,8,9,10-d8-6-carboxamide, 1a,10b-dihydro-1a,10b-d2-
- Carbamazepine 10,11 epoxide-d10
- 1a,10b-Dihydro-1a,10b-d2-6H-dibenz[b,f]oxireno[d]azepine-2,3,4,5,7,8,9,10-d8-6-carboxamide
- CARBAMAZEPINE-10,11-EPOXIDE-D10 (RINGS-D10)
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Carbamazepine 10, 11 Epoxide-d10
CAS:Carbamazepine 10, 11 Epoxide-d10Formula:C15H2D10N2O2Purity:99%Molecular weight:262.33Carbamazepine-10,11-epoxide-d10 (rings-d10)
CAS:Purity:98 atom % DColor and Shape:Off White SolidMolecular weight:262.3310,11-Epoxide Carbamazepine- d10
CAS:Controlled ProductFormula:C15D10H2N2O2Color and Shape:NeatMolecular weight:262.3296Carbamazepine-10,11-epoxide-D10 (rings-D10)
CAS:Carbamazepine-10,11-epoxide-D10 (rings-D10) is a deuterated compound of Carbamazepine-10,11-epoxide. Carbamazepine-10,11-epoxide (T37149) has a CAS number of 36507-30-9. Carbamazepine 10,11-epoxide is an active metabolite of the anticonvulsant carbamazepine[1][2].It is formed from carbamazepine by the cytochrome P450 (CYP) isoforms CYP3A4 and CYP2C8 in microsomes prepared from HepG2 cells expressing CYP3A4 or CYP2C8, respectively[1].Carbamazepine 10,11-epoxide has anticonvulsant activity against maximal electroshock-induced seizures in mice.2It has been found in wastewater effluent[3].Formula:C15H12N2O2Molecular weight:262.3296Carbamazepine-10,11-epoxide-d10 (rings-d10)
CAS:Controlled ProductCarbamazepine-10,11-epoxide-d10 (rings-d10) is a metabolite of carbamazepine that has been shown to have pharmacological properties similar to those of the parent compound. It is used in drug development, metabolism studies, and as an impurity standard for pharmaceutical products. Carbamazepine-10,11-epoxide-d10 (rings-d10) is not found in nature and can be synthesized from carbamazepine. This metabolite has a purity of at least 98% and may be used as an analytical standard or as a research and development compound for pharmacopoeia.Formula:C15H2D10N2O2Purity:Min. 95%Molecular weight:262.33 g/mol
