CAS 1222-98-6
:4-Nitrochalcone
Description:
4-Nitrochalcone is an organic compound characterized by its structure, which consists of a chalcone backbone with a nitro group positioned at the para position of one of the aromatic rings. It typically appears as a yellow crystalline solid and is known for its role in various chemical reactions, particularly in organic synthesis and as an intermediate in the production of other compounds. The presence of the nitro group enhances its reactivity, making it useful in electrophilic substitution reactions. 4-Nitrochalcone exhibits notable biological activities, including potential anti-inflammatory and antimicrobial properties, which have garnered interest in medicinal chemistry. Its solubility varies depending on the solvent, and it is generally more soluble in organic solvents than in water. As with many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4-Nitrochalcone serves as an important compound in both synthetic and pharmaceutical chemistry, contributing to the development of new materials and therapeutic agents.
Formula:C15H11NO3
InChI:InChI=1/C15H11NO3/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19/h1-11H/b11-8+
InChI key:InChIKey=WDZGGAFMGIOIQS-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=C(N(=O)=O)C=C1)(=O)C2=CC=CC=C2
Synonyms:- (2E)-3-(4-nitrophenyl)-1-phenylprop-2-en-1-one
- (4-Nitrobenzylidene)acetophenone
- 1-(4-Nitrophenyl)-3-oxo-3-phenylpropene
- 1-Phenyl-3-(4-nitrophenyl)-2-propen-1-one
- 1-Phenyl-3-(4-nitrophenyl)-2-propenone
- 2-Propen-1-one, 3-(4-nitrophenyl)-1-phenyl-
- 3-(4-Nitrophenyl)-1-Phenylprop-2-En-1-One
- 3-(4-Nitrophenyl)-1-phenyl-2-propen-1-one
- 3-(p-Nitrophenyl)-1-phenyl-2-propen-1-one
- 4-Nitrostyryl phenyl ketone
- Chalcone, 4-nitro-
- NSC 3383
- NSC 636936
- p-Nitrobenzylideneacetophenone
- p-Nitrochalcone
- p-Nitrostyryl phenyl ketone
- 4-Nitrochalcone
- PARA-NITROBENZYLIDENEACETOPHENONE
- 3-(4-nitrophenyl)-1-phenyl-2-propen-1-on
- 4-nitrocalone
- trans-4-Nitrochalcone
- 4-nitro-chalcon
- 4-Nitrostyrylphenyl ketone
- 2-(4-Nitrobenzylidene)acetophenone
- β-(4-Nitrophenyl)acrylophenone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Nitrochalcone
CAS:Formula:C15H11NO3Purity:>95.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:253.262-Propen-1-one, 3-(4-nitrophenyl)-1-phenyl-
CAS:Formula:C15H11NO3Purity:99%Color and Shape:SolidMolecular weight:253.25274-Nitrochalcone
CAS:4-NitrochalconeFormula:C15H11NO3Purity:≥95%Color and Shape: mustard yellow (hint of green). fluffy crystalline powderMolecular weight:253.25g/mol4-Nitrochalcone
CAS:4-Nitrochalcone is a synthetic chalcone derivative, which is an organic compound characterized by the presence of a three-carbon α,β-unsaturated carbonyl system. Chalcones are notable for their role as intermediates in various chemical syntheses, owing to their versatile scaffold. As a synthetic compound, 4-Nitrochalcone is typically derived through the Claisen-Schmidt condensation of an appropriate aldehyde and ketone, specifically involving a nitro-substituted benzaldehyde and an acetophenone.
Formula:C15H11NO3Purity:Min. 95%4-Nitrochalcone
CAS:4-Nitrochalcone (2-(4-Nitrobenzylidene)acetophenone) inhibits proteasomes and suppresses TNFα-induced NF-κB activity.Formula:C15H11NO3Color and Shape:SolidMolecular weight:253.25





