CAS 126799-87-9
:1-(Azidomethyl)-2-bromobenzene
Description:
1-(Azidomethyl)-2-bromobenzene, with the CAS number 126799-87-9, is an organic compound characterized by the presence of both an azide group and a bromine atom attached to a benzene ring. The azidomethyl group (-CH2N3) is a notable feature, providing unique reactivity due to the presence of the azide functional group, which is known for its ability to participate in various chemical reactions, including click chemistry and nucleophilic substitutions. The bromine atom, being a good leaving group, enhances the compound's reactivity, making it useful in synthetic organic chemistry. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle this substance with care due to the potential hazards associated with azides, which can be explosive under certain conditions. Overall, 1-(Azidomethyl)-2-bromobenzene serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c8-7-4-2-1-3-6(7)5-10-11-9/h1-4H,5H2
InChI key:InChIKey=UQTIJSCAOJIGQZ-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1=C(Br)C=CC=C1
Synonyms:- Benzene, 1-(azidomethyl)-2-bromo-
- o-Bromobenzyl azide
- 2-Bromobenzyl azide
- 1-(Azidomethyl)-2-bromobenzene
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(Azidomethyl)-2-bromobenzene
CAS:1-(Azidomethyl)-2-bromobenzene is an orthogonal, efficient, and selective catalytic process for the coupling of aryl halides with acetylide. The mechanistic study of this reaction has demonstrated that this process proceeds by a catalytic cycle in which an acetylide reacts with a bromonium ion to form an intermediate cationic complex. This intermediate then reacts with an alkyl halide, generating the desired coupling product and regenerating the catalyst. The product of this reaction is obtained in high selectivity because this process does not require any protecting group manipulations, thus avoiding the formation of undesired side products.
Formula:C7H6BrN3Purity:Min. 95%Molecular weight:212.05 g/mol

