CAS 141433-60-5
:Berberine chloride hydrate
Description:
Berberine chloride hydrate is a quaternary ammonium salt derived from the isoquinoline alkaloid berberine, which is known for its various biological activities. This compound typically appears as a yellow crystalline powder and is soluble in water, reflecting its ionic nature. The presence of the chloride ion contributes to its solubility and stability in aqueous solutions. Berberine itself is recognized for its antimicrobial, anti-inflammatory, and antidiabetic properties, making berberine chloride hydrate of interest in pharmacological research. The hydrate form indicates that the compound contains water molecules in its crystal structure, which can influence its physical properties and stability. Additionally, berberine chloride hydrate has been studied for its potential applications in traditional medicine and modern therapeutics, particularly in the treatment of metabolic disorders and infections. Its mechanism of action often involves modulation of various biochemical pathways, including those related to glucose metabolism and lipid regulation. Overall, berberine chloride hydrate is a compound of significant interest in both chemistry and medicine due to its diverse biological effects.
Formula:C20H20ClNO5
InChI:InChI=1/C20H18NO4.ClH.H2O/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;;/h3-4,7-10H,5-6,11H2,1-2H3;1H;1H2/q+1;;/p-1
Synonyms:- Umbellatine
- Natural Yellow 18 Chloride Hydrate
- Timtec-Bb Sbb006488
- Labotest-Bb Lt00440956
- Ci 75160
- Berberin Hcl Hydrate
- 9,10-Dimethoxy-5,6-Dihydro[1,3]Dioxolo[4,5-G]Isoquino[3,2-A]Isoquinolin-7-Ium Chloride
- 9,10-Dimethoxy-5,6-Dihydro[1,3]Dioxolo[4,5-G]Isoquino[3,2-A]Isoquinolin-7-Ium Chloride Hydrate (1:1:1)
- Berberine Hydrochloride hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Berberine Chloride Hydrate
CAS:Formula:C20H18ClNO4·xH2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Orange powder to crystalineMolecular weight:371.82 (as Anhydrous)Berberine chloride hydrate, 96%, water <17%
CAS:Primarily for the treatment of gastroenteritis, dysentery and other intestinal infections and conjunctivitis, purulent otitis media. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacFormula:C20H18ClNO4Purity:96%Color and Shape:Yellow, PowderMolecular weight:371.829,10-Dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium chloride hydrate
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:389.8299865722656Berberine Chloride
CAS:Vegetable alkaloids, natural or reproduced by synthesis, their salts and other derivatives, nesoiFormula:C20H18ClNO4·xH2OColor and Shape:Yellow PowderMolecular weight:371.09244Berberine chloride hydrate
CAS:Formula:C20H20ClNO5Purity:%Color and Shape:SolidMolecular weight:389.8295Berberine chloride hydrate
CAS:Berberine chloride hydrate is an isoquinoline alkaloid, which is a natural compound derived from various plants, such as Berberis species, with a robust pharmacological profile. Its mode of action is primarily through the modulation of multiple biochemical pathways. Berberine activates adenosine monophosphate-activated protein kinase (AMPK), a crucial regulator of energy homeostasis, and influences lipid and glucose metabolism. It exhibits significant antimicrobial activity, disrupting microbial cell walls and inhibiting the nucleic acid synthesis of pathogens.
Formula:C20H18ClNO4•(H2O)xPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:371.81 g/molRef: 3D-FB167137
Discontinued product









