CAS 1442433-71-7
:9-Mesityl-10-methylacridinium tetrafluoroborate
Description:
9-Mesityl-10-methylacridinium tetrafluoroborate is a chemical compound that belongs to the class of acridinium salts, which are known for their photophysical properties and applications in photochemistry and organic synthesis. This compound features a mesityl group, which contributes to its stability and solubility, and a tetrafluoroborate anion, which is a common counterion that enhances the compound's ionic character. The acridinium moiety is characterized by its ability to undergo photoinduced electron transfer, making it useful in various applications such as fluorescence-based sensing and as a photoinitiator in polymerization processes. The tetrafluoroborate salt form typically exhibits good thermal stability and solubility in polar organic solvents. Additionally, the compound's unique structure allows for potential applications in the development of advanced materials and in the field of organic electronics. Overall, 9-Mesityl-10-methylacridinium tetrafluoroborate is notable for its intriguing chemical properties and versatility in research and industrial applications.
Formula:C23H22BF4N
InChI:InChI=1S/C23H22N.BF4/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23;2-1(3,4)5/h5-14H,1-4H3;/q+1;-1
InChI key:KKMWMXQQOIIJIZ-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
9-Mesityl-10-Methylacridin-10-Ium Tetrafluoroborate
CAS:9-Mesityl-10-Methylacridin-10-Ium TetrafluoroborateFormula:C23H22BF4NPurity:97%Color and Shape:SolidMolecular weight:399.239-Mesityl-10-methylacridin-10-ium tetrafluoroborate
CAS:Formula:C23H22BF4NPurity:96%Color and Shape:SolidMolecular weight:399.2321Ref: IN-DA00ASEV
100mg43.00€250mg57.00€1g116.00€5g386.00€10g632.00€50g1,489.00€100g2,850.00€250g5,700.00€9-Mesityl-10-methylacridinium Tetrafluoroborate
CAS:Controlled ProductStability Hygroscopic
Applications 9-Mesityl-10-methylacridinium Tetrafluoroborate can be used for the synthesis of γ-butyrolactones, γ-lactams and pyrrolidines. 9-Mesityl-10-methylacridinium Tetrafluoroborate has been reported by Nicewicz et al. to mediate myriad transformations through Photoredox Catalysis. The applications include the anti-Markovnikov hydroamination of alkenes and addition of carboxylic acids to alkenes and the hydrotrifluoromethylation of styrenes using the Langlois reagent S673690.
References Gesmundo, N. J. et al.: Org. Lett. 17, 1316 (2015); Zeller, M. A., et al.: Org. Lett. 16, 4810 (2014); Nicewicz et al., J. Am. Chem. Soc., 135 (26), 9588–9591(2013)Formula:C23H22BF4NColor and Shape:NeatMolecular weight:399.239-Mesityl-10-methylacridin-10-ium tetrafluoroborate
CAS:9-Mesityl-10-methylacridin-10-ium tetrafluoroborateFormula:C23H22BF4NPurity:97%Molecular weight:399.23




