CAS 145672-81-7: N-acetyl-3-(2-naphthalenyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridinyl)-D-alanyl-L-seryl-L-tyrosyl-N5-(aminocarbonyl)-D-ornithyl-L-leucyl-L-arginyl-L-prolyl-, acetate (salt)
Description:N-acetyl-3-(2-naphthalenyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridinyl)-D-alanyl-L-seryl-L-tyrosyl-N5-(aminocarbonyl)-D-ornithyl-L-leucyl-L-arginyl-L-prolyl-, acetate (salt), with CAS number 145672-81-7, is a complex synthetic peptide that exhibits a range of characteristics typical of peptide compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and methanol, and may have limited solubility in non-polar solvents. The presence of various amino acid residues suggests potential biological activity, possibly as a pharmaceutical agent or research compound. Its structure includes multiple chiral centers, indicating that it may exhibit stereospecific properties. The acetate salt form implies enhanced stability and solubility, which is beneficial for formulation in biological studies. As with many peptides, it may be sensitive to hydrolysis and degradation under certain conditions, necessitating careful handling and storage. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and biochemistry.
Formula:C70H92ClN17O14xC2H4O2
InChI:InChI=1/C70H92ClN17O14.C2H4O2/c1-39(2)31-52(61(94)82-51(15-9-28-77-69(73)74)68(101)88-30-10-16-58(88)67(100)79-40(3)59(72)92)83-60(93)50(14-8-29-78-70(75)102)81-63(96)54(34-43-20-25-49(91)26-21-43)86-66(99)57(38-89)87-65(98)56(36-45-11-7-27-76-37-45)85-64(97)55(33-42-18-23-48(71)24-19-42)84-62(95)53(80-41(4)90)35-44-17-22-46-12-5-6-13-47(46)32-44;1-2(3)4/h5-7,11-13,17-27,32,37,39-40,50-58,89,91H,8-10,14-16,28-31,33-36,38H2,1-4H3,(H2,72,92)(H,79,100)(H,80,90)(H,81,96)(H,82,94)(H,83,93)(H,84,95)(H,85,97)(H,86,99)(H,87,98)(H4,73,74,77)(H3,75,78,102);1H3,(H,3,4)/t40-,50-,51+,52+,53-,54-,55+,56-,57-,58?;/m1./s1