CAS 16517-11-6: perfluorooctadecanoic acid
Description:Perfluorooctadecanoic acid (PFODA) is a perfluorinated carboxylic acid characterized by a long carbon chain, specifically consisting of 18 carbon atoms fully saturated with fluorine atoms. This structure imparts unique properties, including high thermal stability, chemical resistance, and low surface tension. PFODA is part of a larger class of perfluoroalkyl substances (PFAS), which are known for their persistence in the environment and potential bioaccumulation in living organisms. The compound is typically used in various industrial applications, including surfactants, coatings, and as a processing aid in the manufacture of fluoropolymers. Due to its strong carbon-fluorine bonds, PFODA exhibits low reactivity, making it resistant to degradation. However, concerns have been raised regarding its environmental impact and potential health effects, leading to increased regulatory scrutiny. As a result, PFODA and other PFAS are subjects of ongoing research to understand their behavior in ecosystems and their implications for human health.
Formula:C18HF35O2
InChI:InChI=1S/C18HF35O2/c19-2(20,1(54)55)3(21,22)4(23,24)5(25,26)6(27,28)7(29,30)8(31,32)9(33,34)10(35,36)11(37,38)12(39,40)13(41,42)14(43,44)15(45,46)16(47,48)17(49,50)18(51,52)53/h(H,54,55)
InChI key:InChIKey=ZTSDOGSKTICNPQ-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-Pentatriacontafluorooctadecanoic acid
- Octadecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-pentatriacontafluoro-
- Octadecanoic acid, pentatriacontafluoro-
- Pentatriacontafluorooctadecanoic Acid
- Perfluoro n-octadecanoic acid
- Perfluorostearic acid
- Perfluorooctadecanoic acid