CAS 30334-69-1: Perfluorobutanesulfonamide
Description:Perfluorobutanesulfonamide (PFBS) is a synthetic chemical compound belonging to the class of perfluoroalkyl substances (PFAS). It is characterized by a perfluorinated carbon chain, specifically a four-carbon backbone, which is fully fluorinated, contributing to its unique chemical properties. PFBS is known for its high thermal and chemical stability, low surface tension, and resistance to degradation, making it persistent in the environment. The sulfonamide functional group imparts additional properties, such as solubility in water and potential bioactivity. PFBS has been used in various applications, including as a surfactant and in the production of water-repellent coatings. However, due to growing environmental and health concerns associated with PFAS, including potential toxicity and bioaccumulation, regulatory scrutiny has increased. Studies have indicated that PFBS may have effects on human health and ecosystems, prompting ongoing research into its environmental fate and potential alternatives. Overall, PFBS exemplifies the challenges posed by persistent organic pollutants in modern chemistry and environmental science.
Formula:C4H2F9NO2S
InChI:InChI=1S/C4H2F9NO2S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H2,14,15,16)
InChI key:InChIKey=FUVKFLJWBHVMHX-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonamide
- Nonafluorobutanesulfonamide
- n-Nonafluorobutanesulfonamide
- 1-Butanesulfonamide, 1,1,2,2,3,3,4,4,4-nonafluoro-
- Perfluorobutanesulfonamide
- Perfluorobutylsulfonamide
- 1,1,2,2,3,3,4,4,4-Nonafluoro-butane-1-sulfonic acid amide
- Perfluorobutylsulphonamide
- Perfluorobutylsulphonamide 97%