CAS 183675-82-3: Penthiopyrad
Description:Penthiopyrad is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of pyridazinones and is characterized by its broad-spectrum activity against a range of pathogens, including those affecting fruits, vegetables, and ornamental plants. Penthiopyrad functions by inhibiting the mitochondrial respiration of fungi, disrupting their energy production and ultimately leading to cell death. This compound is known for its systemic properties, allowing it to be absorbed and translocated within plants, providing effective protection against fungal infections. Additionally, penthiopyrad exhibits low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional fungicides. Its formulation often includes various adjuvants to enhance its efficacy and stability. As with all pesticides, proper handling and application according to regulatory guidelines are essential to minimize risks to human health and the environment.
Formula:C16H20F3N3OS
InChI:InChI=1S/C16H20F3N3OS/c1-9(2)7-10(3)13-12(5-6-24-13)20-15(23)11-8-22(4)21-14(11)16(17,18)19/h5-6,8-10H,7H2,1-4H3,(H,20,23)
InChI key:InChIKey=PFFIDZXUXFLSSR-UHFFFAOYSA-N
SMILES:O=C(NC=1C=CSC1C(C)CC(C)C)C2=CN(N=C2C(F)(F)F)C
- Synonyms:
- 1-methyl-N-[2-(4-methylpentan-2-yl)thiophen-3-yl]-3-(trifluoromethyl)
- 1-methyl-N-[2-(4-methylpentan-2-yl)thiophen-3-yl]-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-
- Dpx-Lem 17
- Fontelis
- Mtf 753
- N-[2-(1,3-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide
- Vertisan
- pyrazole-4-carboxamide
- 1-methyl-N-[2-(4-methylpentan-2-yl)thiophen-3-yl]-3-(trifluoromethyl)
- See more synonyms
- pyrazole-4-carboxamide
- Penthiopyrad
