CAS 156052-68-5: Zoxamide
Description:Zoxamide is a chemical compound primarily used as a fungicide in agricultural applications, particularly for controlling diseases in crops such as potatoes and tomatoes. It belongs to the class of compounds known as benzamide derivatives and exhibits a unique mode of action by inhibiting the growth of fungal pathogens. Zoxamide is characterized by its relatively low toxicity to mammals and beneficial organisms, making it a preferred choice in integrated pest management strategies. The compound is typically applied as a foliar spray and is effective against a range of fungal diseases, including late blight and downy mildew. Its stability and efficacy under various environmental conditions contribute to its utility in crop protection. Additionally, Zoxamide has a specific chemical structure that allows it to interact with fungal cellular processes, disrupting their development and reproduction. As with all pesticides, proper handling and application are essential to minimize environmental impact and ensure safety.
Formula:C14H16Cl3NO2
InChI:InChI=1S/C14H16Cl3NO2/c1-4-14(3,12(19)7-15)18-13(20)9-5-10(16)8(2)11(17)6-9/h5-6H,4,7H2,1-3H3,(H,18,20)
InChI key:InChIKey=SOUGWDPPRBKJEX-UHFFFAOYSA-N
SMILES:O=C(NC(C(=O)CCl)(C)CC)C1=CC(Cl)=C(C(Cl)=C1)C
- Synonyms:
- 3,5-Dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-4-methylbenzamide
- 3,5-dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide
- Benzamide, 3,5-dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-4-methyl-
- Rh-7281
- Zoxamide (Bsi,Iso)
- Zoxium
- Zoxamide

Benzamide, 3,5-dichloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-4-methyl-
Ref: IN-DA001OGV
Undefined size | To inquire |

Zoxamide 100 µg/mL in Acetone
Controlled ProductRef: 04-GA09011142AC
1ml | 76.00 € |

Zoxamide
Controlled ProductRef: 04-C17980000
100mg | 295.00 € |

LC PestiMix 2 10 µg/mL in Acetonitrile
Ref: 04-A50000802AL
1ml | To inquire |

GC PestiMix 5 10 µg/mL in Isooctane:Toluene (50:50)
Controlled ProductRef: 04-A50000296IT
1ml | 1,112.00 € |

GB 23200.121-2021 Pesticide Mixture 6 50 µg/mL in Acetonitrile
Controlled ProductRef: 04-A50000726AL
1ml | 127.00 € |

Ref: 7W-GW7312
100mg | 327.00 € | ||
500mg | 1,171.00 € |

Zoxamide
Ref: TM-T78591
5mg | To inquire | ||
50mg | To inquire |

Zoxamide
Ref: 3D-FZ28789
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |