CAS 19408-84-5: dihydrocapsaicin
Description:Dihydrocapsaicin is a chemical compound classified as a capsaicinoid, which is primarily found in chili peppers. It is known for its pungent flavor and is responsible for the heat sensation associated with spicy foods. Dihydrocapsaicin has a molecular formula of C18H27NO3 and features a long hydrophobic carbon chain, contributing to its lipophilic nature. This compound exhibits a high degree of solubility in organic solvents but is less soluble in water. Its structure includes an amide functional group, which is characteristic of capsaicinoids. Dihydrocapsaicin is often studied for its potential health benefits, including analgesic properties and its role in metabolism. Additionally, it is used in various applications, such as food flavoring and topical analgesics. The compound's pungency is measured using the Scoville scale, where it ranks among the hotter capsaicinoids, although it is less potent than capsaicin itself. Overall, dihydrocapsaicin is a significant compound in both culinary and medicinal contexts, contributing to the unique characteristics of spicy foods.
Formula:C18H29NO3
InChI:InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21)
InChI key:InChIKey=XJQPQKLURWNAAH-UHFFFAOYSA-N
SMILES:O=C(NCC1=CC=C(O)C(OC)=C1)CCCCCCC(C)C
- Synonyms:
- 6,7-Dihydrocapsaicin
- 8-methyl-N-vanillylnonanamide
- Capsaicin, dihydro-
- N-(4-hydroxy-3-methoxybenzyl)-8-methylnonanamide
- N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide
- Nonanamide, 8-methyl-N-vanillyl-
- Nonanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl-
- Dihydrocapsaicin
![Nonanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl-](https://static.cymitquimica.com/products/IN/thumb/DA00I31N.jpg)
