CAS 195733-43-8
:Atrasentan hydrochloride
Description:
Atrasentan hydrochloride is a selective endothelin receptor antagonist primarily used in the treatment of various cancers, particularly prostate cancer. It functions by blocking the action of endothelin-1, a potent vasoconstrictor that can promote tumor growth and metastasis. The substance is characterized by its hydrochloride salt form, which enhances its solubility and stability in aqueous solutions, making it suitable for pharmaceutical formulations. Atrasentan has a specific affinity for the endothelin A receptor, which is implicated in various pathological processes, including fibrosis and hypertension. Its chemical structure includes a complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its biological activity. The compound is typically administered orally and has undergone various clinical trials to assess its efficacy and safety profile. As with many pharmaceuticals, potential side effects may include cardiovascular issues and liver function alterations, necessitating careful monitoring during treatment. Overall, Atrasentan hydrochloride represents a targeted therapeutic approach in oncology, aiming to mitigate the effects of endothelin signaling in cancer progression.
Formula:C29H38N2O6HCl
InChI:InChI=1/C29H38N2O6.ClH/c1-4-6-14-30(15-7-5-2)26(32)18-31-17-23(21-10-13-24-25(16-21)37-19-36-24)27(29(33)34)28(31)20-8-11-22(35-3)12-9-20;/h8-13,16,23,27-28H,4-7,14-15,17-19H2,1-3H3,(H,33,34);1H/t23-,27-,28+;/m1./s1
Synonyms:- (2R,3R,4S)-4-(1,3-Benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Pyrrolidinecarboxylicacid,4-(1,3-benzodioxol-5-yl)-1-[2-(dibutylamino)-2-oxoethyl]-2-(4-methoxyphenyl)-,hydrochloride (1:1), (2R,3R,4S)-
CAS:Formula:C29H39ClN2O6Purity:95%Color and Shape:SolidMolecular weight:547.0828Atrasentan hydrochloride
CAS:Endothelin receptor antagonist
Formula:C29H38N2O6·HClPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:547.08 g/molAtrasentan hydrochloride
CAS:Atrasentan hydrochloride (ABT-627 hydrochloride) is an antagonist of the endothelin receptor(IC50 = 55.1 μM for ETA).Formula:C29H39ClN2O6Purity:99.75%Color and Shape:SolidMolecular weight:547.08



