CAS 19672-59-4: 4,4'-Dichlorochalcone

Description:4,4'-Dichlorochalcone is an organic compound belonging to the chalcone class, characterized by its structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. Its molecular formula is C15H12Cl2O, indicating the presence of two chlorine atoms, which significantly influence its chemical properties and reactivity. This compound typically appears as a yellow solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the dichloro substituents enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. 4,4'-Dichlorochalcone can undergo various chemical reactions, such as nucleophilic substitutions and cyclization, which are valuable in the development of new pharmaceuticals. Additionally, it is soluble in organic solvents, which facilitates its use in various chemical applications. As with many chlorinated compounds, safety precautions should be taken when handling 4,4'-Dichlorochalcone due to its potential toxicity and environmental impact.

Formula:C₁₅H₁₀Cl₂O

InChI:InChI=1/C15H10Cl2O/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12/h1-10H/b10-3+

Synonyms:
1,3-Bis(4-Chlorophenyl)Prop-2-En-1-One
(2E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4,4'-Dichlorochalcone REF: 3B-D4846CAS: 19672-59-4	>98.0%(GC)	78.00 €~339.00 €	Thu 10 Apr 25
4,4'-Dichlorochalcone, 98+% REF: 02-L10717CAS: 19672-59-4	98+%	To inquire	Fri 11 Apr 25
2-Propen-1-one, 1,3-bis(4-chlorophenyl)- REF: IN-DA00AOR5CAS: 19672-59-4	98%	47.00 €~668.00 €	Thu 17 Apr 25
4,4'-Dichlorochalcone REF: 54-OR24965CAS: 19672-59-4	- - -	32.00 €~1,763.00 €	Mon 21 Apr 25
4,4'-Dichlorochalcone REF: 3D-UAA67259CAS: 19672-59-4	Min. 95%	- - -	Discontinued product