CAS 19672-59-4
:4,4'-Dichlorochalcone
Description:
4,4'-Dichlorochalcone is an organic compound belonging to the chalcone class, characterized by its structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. Its molecular formula is C15H12Cl2O, indicating the presence of two chlorine atoms, which significantly influence its chemical properties and reactivity. This compound typically appears as a yellow solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the dichloro substituents enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. 4,4'-Dichlorochalcone can undergo various chemical reactions, such as nucleophilic substitutions and cyclization, which are valuable in the development of new pharmaceuticals. Additionally, it is soluble in organic solvents, which facilitates its use in various chemical applications. As with many chlorinated compounds, safety precautions should be taken when handling 4,4'-Dichlorochalcone due to its potential toxicity and environmental impact.
Formula:C15H10Cl2O
InChI:InChI=1/C15H10Cl2O/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12/h1-10H/b10-3+
Synonyms:- 1,3-Bis(4-Chlorophenyl)Prop-2-En-1-One
- (2E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,4'-Dichlorochalcone
CAS:Formula:C15H10Cl2OPurity:>98.0%(GC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:277.144,4'-Dichlorochalcone, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C15H10Cl2OPurity:98+%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:277.14




