CAS 2023-48-5

difluoro(triphenyl)-lambda~5~-bismuthane

Description:

Difluoro(triphenyl)-lambda^5-bismuthane, with the CAS number 2023-48-5, is a bismuth-containing organofluorine compound characterized by the presence of a bismuth atom bonded to two fluorine atoms and three phenyl groups. This compound exhibits unique properties due to the presence of the heavy metal bismuth, which can influence its reactivity and stability. The triphenyl groups contribute to its steric bulk, potentially affecting its solubility and interaction with other chemical species. The difluoro substituents may enhance its reactivity, making it a candidate for various chemical transformations. Additionally, the presence of fluorine atoms can impart distinctive electronic properties, influencing the compound's behavior in chemical reactions. Such compounds are of interest in materials science and medicinal chemistry due to their potential applications in drug development and as precursors in the synthesis of more complex organometallic compounds. However, specific applications and reactivity would depend on the broader context of its use and the conditions under which it is studied.

Formula: C₁₈H₁₅BiF₂

InChI: InChI=1/3C6H5.Bi.2FH/c3*1-2-4-6-5-3-1;;;/h3*1-5H;;2*1H/q;;;+2;;/p-2/rC18H15BiF2/c20-19(21,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H

InChI key: OSGJIYNQSIPLAQ-UHFFFAOYSA-L

SMILES: C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F

Synonyms:

• Bismuth, Difluorotriphenyl-

Triphenylbismuth Difluoride

CAS: 2023-48-5

Formula: C₁₈H₁₅BiF₂

Purity: >97.0%(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 478.30

Ref: 3B-T2657

Triphenylbismuth Difluoride

CAS: 2023-48-5

Triphenylbismuth Difluoride

Formula: C₁₈H₁₅BiF₂

Purity: 95%

Color and Shape: Solid-Crystals

Molecular weight: 478.28888

Ref: 54-PC906593

Triphenylbismuth difluoride

CAS: 2023-48-5

Triphenylbismuth difluoride is a fluorinated organometallic compound that has been used as a detergent additive in laundry and dishwashing products. It is also used in the synthesis of triarylbismuth, an important precursor for boronic esters, which are widely used as catalysts in organic reactions. Triphenylbismuth difluoride has an inhibitory effect on bacterial growth and is active against some strains of methicillin-resistant Staphylococcus aureus. This compound binds to the active site of metalloproteins, such as enzymes and non-enzymatic proteins, by coordinate covalent bonding with metal ions or by forming chelate complexes with metal ions.

Formula: C₁₈H₁₅BiF₂

Color and Shape: White Off-White Powder

Molecular weight: 478.29 g/mol

Ref: 3D-FT60668