CymitQuimica logo

CAS 202480-74-8

:

1,3-Dioxolan-2-one-4,4,5-d3,5-(methyl-d3)- (9CI)

Description:
1,3-Dioxolan-2-one-4,4,5-d3,5-(methyl-d3)- (9CI), with the CAS number 202480-74-8, is a synthetic organic compound characterized by its cyclic structure that includes a dioxolane ring and a lactone functional group. This compound features deuterated methyl groups, which are isotopically labeled with deuterium, enhancing its utility in various analytical applications, particularly in NMR spectroscopy. The presence of the dioxolane and lactone functionalities suggests potential reactivity in organic synthesis, including applications in polymer chemistry and as intermediates in the production of pharmaceuticals. Its unique isotopic labeling can also facilitate studies in metabolic pathways and tracer studies in biological systems. The compound is typically handled under standard laboratory conditions, and its stability and reactivity may vary depending on the specific conditions of use. As with many chemical substances, appropriate safety measures should be observed when handling this compound to mitigate any potential hazards.
Formula:C4D6O3
InChI:InChI=1S/C4H6O3/c1-3-2-6-4(5)7-3/h3H,2H2,1H3/i1D3,2D2,3D
InChI key:RUOJZAUFBMNUDX-LIDOUZCJSA-N
SMILES:[2H]C1(C(OC(=O)O1)([2H])C([2H])([2H])[2H])[2H]
Synonyms:
  • Propylene-d6carbonate
Found 3 products.