CAS 2070015-13-1

Formula: C23H25ClN4O

InChI: InChI=1S/C23H24N4O.ClH/c1-2-8-17(9-3-1)16-24-22-18-10-4-5-11-19(18)25-23(26-22)27-14-15-28-21-13-7-6-12-20(21)27;/h1-3,6-9,12-13H,4-5,10-11,14-16H2,(H,24,25,26);1H

InChI key: DYHMHNNBOLCULH-UHFFFAOYSA-N

SMILES: C1CCC2=C(C1)C(=NC(=N2)N3CCOC4=CC=CC=C43)NCC5=CC=CC=C5.Cl

N-Benzyl-2-(2,3-dihydro-4H-benzo[b][1,4]oxazin-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine hydrochloride

CAS: 2070015-13-1

Formula: C₂₃H₂₅ClN₄O

Purity: 99%

Molecular weight: 408.9238

Ref: IN-DA01EOOU

ML241 hydrochloride

CAS: 2070015-13-1

ML241 hydrochloride

Formula: C₂₃H₂₅ClN₄O

Purity: ≥98%

Molecular weight: 408.92

Ref: 54-BUP10360

ML241 HCl

CAS: 2070015-13-1

N-Benzyl-2-(2,3-dihydro-4H-benzo[b][1,4]oxazin-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine hydrochloride

Formula: C₂₃H₂₅ClN₄O

Purity: 99%

Molecular weight: 408.92

Ref: IN-DG764561

ML241 hydrochloride

CAS: 2070015-13-1

ML241 is a potent and selective inhibitors of p97 ATPase.ML241 inhibits degradation of a p97-dependent but not a p97-independent proteasome substrate in a dual-

Formula: C₂₃H₂₅ClN₄O

Purity: 99.91% - 99.97%

Color and Shape: Solid

Molecular weight: 408.92

Ref: TM-T4684

ML241 hydrochloride

CAS: 2070015-13-1

ML241 hydrochloride is a small molecule inhibitor, which is synthesized specifically for laboratory research purposes. It originates from chemical synthesis processes aimed at producing highly selective inhibitors for biochemical pathways. This compound is known for its role in inhibiting oxysterol-binding protein (OSBP), thereby interfering with lipid signaling pathways within cells.

Formula: C₂₃H₂₅ClN₄O

Purity: Min. 95%

Molecular weight: 408.92 g/mol

Ref: 3D-VHD01513