CymitQuimica logo

CAS 207502-65-6

:

Glycine, N-[[4-(trifluoromethyl)-3-pyridinyl]carbonyl]-

Description:
Glycine, N-[[4-(trifluoromethyl)-3-pyridinyl]carbonyl]- is a chemical compound characterized by its structure, which includes a glycine moiety linked to a pyridine ring substituted with a trifluoromethyl group. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. Additionally, the carbonyl group contributes to the compound's reactivity and potential interactions in biological systems. As a small molecule, it may exhibit various biological activities, making it of interest in research related to drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with fluorinated groups, which can pose environmental and health risks.
Formula:C9H7F3N2O3
InChI:InChI=1S/C9H7F3N2O3/c10-9(11,12)6-1-2-13-3-5(6)8(17)14-4-7(15)16/h1-3H,4H2,(H,14,17)(H,15,16)
InChI key:AXMBYGGSBXWTEY-UHFFFAOYSA-N
SMILES:C1=CN=CC(=C1C(F)(F)F)C(=O)NCC(=O)O
Found 10 products.