CAS 81-04-9
:1,5-Naphthalenedisulfonic acid
Description:
1,5-Naphthalenedisulfonic acid, with the CAS number 81-04-9, is an organic compound characterized by the presence of two sulfonic acid groups (-SO3H) attached to a naphthalene ring at the 1 and 5 positions. This compound appears as a white to light yellow crystalline solid and is soluble in water, making it useful in various applications. It is primarily utilized as a dye intermediate and in the synthesis of other chemical compounds due to its ability to act as a sulfonating agent. The presence of sulfonic acid groups imparts strong acidic properties, allowing it to participate in various chemical reactions, including electrophilic substitution. Additionally, 1,5-naphthalenedisulfonic acid can exhibit properties such as high thermal stability and the ability to form salts with bases. Its derivatives are often employed in the production of azo dyes and as dispersants in various industrial processes. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C10H8O6S2
InChI:InChI=1S/C10H8O6S2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16)
InChI key:InChIKey=XTEGVFVZDVNBPF-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(C(S(=O)(=O)O)=CC=C2)C=CC1
Synonyms:- 1,5-Naphthalenedisulfonic acid
- Armstrong's acid
- NSC 9588
- Napadisylic acid
- Naphthalene-1,5-Disulfonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,5-Naphthalenedisulfonic Acid Tetrahydrate
CAS:Formula:C10H8O6S2·4H2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:360.351,5-Naphthalenedisulfonic acid
CAS:Formula:C10H8O6S2Purity:97%Color and Shape:SolidMolecular weight:288.2969Ref: IN-DA00ID5J
25g20.00€100g26.00€50g27.00€250g37.00€500g53.00€1kg60.00€2.5kg122.00€5kg172.00€10kg226.00€25kg507.00€Naphthalene-1,5-disulphonic acid
CAS:Naphthalene-1,5-disulphonic acidFormula:C10H8O6S2Purity:98%Color and Shape:SolidMolecular weight:288.296921,5-Naphthalenedisulfonic acid
CAS:1,5-Naphthalenedisulfonic acid is a diazonium salt that is used in wastewater treatment. It can be used in the presence of hydrogen bonding interactions to remove contaminants from wastewater. This chemical has been shown to be effective in biological treatment systems and fluorescence detector applications. 1,5-Naphthalenedisulfonic acid has been shown to react with 2,4-dichlorobenzoic acid to form a coordination complex with a structure that contains two nitrogen atoms and one proton on each side of the central carbon atom. The frequency shift between these two atoms has been determined to be at least 200 MHz. The coordination geometry is octahedral, which means there are six different positions for the proton.Formula:C10H8O6S2Purity:Min. 95%Color and Shape:White Clear LiquidMolecular weight:288.3 g/mol





