CAS 211555-08-7
:3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol
Description:
3-[(6,7-Dimethoxyquinazolin-4-yl)amino]phenol, with the CAS number 211555-08-7, is a chemical compound characterized by its unique structural features, which include a quinazoline moiety and a phenolic group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of methoxy groups enhances its solubility and may influence its interaction with biological targets. As an amino-substituted phenol, it may exhibit properties such as antioxidant activity and the ability to participate in hydrogen bonding due to the hydroxyl group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Its specific interactions and efficacy would depend on further studies, including in vitro and in vivo evaluations. Overall, 3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol represents a compound of interest for research in drug development and chemical biology.
Formula:C16H15N3O3
InChI:InChI=1/C16H15N3O3/c1-21-14-7-12-13(8-15(14)22-2)17-9-18-16(12)19-10-4-3-5-11(20)6-10/h3-9,20H,1-2H3,(H,17,18,19)
SMILES:COc1cc2c(cc1OC)ncnc2Nc1cccc(c1)O
Synonyms:- Phenol, 3-[(6,7-Dimethoxy-4-Quinazolinyl)Amino]-
- 3-[(6,7-Dimethoxyquinazolin-4-yl)amino]phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-[(6,7-Dimethoxyquinazolin-4-yl)amino]phenol
CAS:Formula:C16H15N3O3Purity:98%Color and Shape:SolidMolecular weight:297.3086WHI-P180
CAS:WHI-P180 (Janex 3) is a potent EGFR and Cdk2 inhibitors with IC50 of 4.0 and 1.0 uM, respectively.Formula:C16H15N3O3Purity:99.21%Color and Shape:SolidMolecular weight:297.31WHI-P180
CAS:3-((6,7-Dimethoxyquinazolin-4-yl)amino)phenolFormula:C16H15N3O3Purity:98%Molecular weight:297.31WHI-P180
CAS:WHI-P180 is a potential anticancer agent that has been shown to be effective in inhibiting the growth of human colon cancer cells (HCT116) and CD-1 mice with cancer. WHI-P180 binds to the intracellular targets of mcf-7, a growth factor involved in cell proliferation, which leads to neuronal death. This agent has also been demonstrated to be cytotoxic against monoclonal antibodies and epidermal growth factor receptor (EGFR). WHI-P180 targets ABCG2, an enzyme involved in drug efflux, which may lead to increased efficacy of this drug.
Formula:C16H15N3O3Purity:Min. 95%Molecular weight:297.31 g/mol





