![1,1′-(2,2-Dichloroethenylidene)bis[4-methoxybenzene]](https://static.cymitquimica.com/cas-image/214339-11-22-dichloroethenylidene-bis-4-methoxybenzene.png)
CAS 2132-70-9: 1,1′-(2,2-Dichloroethenylidene)bis[4-methoxybenzene]
Description:1,1′-(2,2-Dichloroethenylidene)bis[4-methoxybenzene], with the CAS number 2132-70-9, is an organic compound characterized by its unique structure, which features a central dichloroethenylidene group flanked by two 4-methoxybenzene moieties. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to its molecular interactions. It is known for its potential applications in materials science, particularly in the development of polymers and as a precursor in organic synthesis. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it of interest in studies related to conductivity and photochemical behavior. Additionally, the dichloroethenylidene unit contributes to its reactivity, allowing for further chemical modifications. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound exemplifies the intersection of organic chemistry and material science, showcasing the importance of functional groups in determining chemical behavior.
Formula:C16H14Cl2O2
InChI:InChI=1S/C16H14Cl2O2/c1-19-13-7-3-11(4-8-13)15(16(17)18)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3
InChI key:InChIKey=YCRYSVKEWAWTGI-UHFFFAOYSA-N
SMILES:ClC(Cl)=C(C1=CC=C(OC)C=C1)C2=CC=C(OC)C=C2
- Synonyms:
- 1,1'-(Dichloroethenylidene)bis(4-methoxybenzene)
- 1,1-Bis(p-methoxyphenyl)-2,2-dichloroethylene
- 1,1-Dichloro-2,2-bis(4-methoxyphenyl) ethene
- 1,1-Dichloro-2,2-bis(4-methoxyphenyl)ethylene
- 1,1-Dichloro-2,2-bis(p-methoxyphenyl)ethylene
- 1,1′-(2,2-Dichloroethenylidene)bis[4-methoxybenzene]
- 2,2-Bis(p-methoxyphenyl)-1,1-dichloroethylene
- 2,2-Dichloro-1,1-bis(4-methoxyphenyl)ethylene
- Benzene, 1,1'-(2,2-Dichloroethenylidene)Bis[4-Methoxy-
- Benzene, 1,1′-(dichloroethenylidene)bis[4-methoxy-
- See more synonyms
- Ethylene, 1,1-dichloro-2,2-bis(p-methoxyphenyl)-
- Methoxychlor olefin
- Methoxychlor-DDE
- NSC 97452
- p,p′-Methoxychlor olefin
4,4'-Methoxychlor olefin 10 µg/mL in Cyclohexane
Controlled ProductRef: 04-L15062000CY
| 10ml | 77.00 € |
Ref: 04-C15062000
| 10mg | 233.00 € |
GC PestiMix 5 10 µg/mL in Isooctane:Toluene (50:50)
Controlled ProductRef: 04-A50000296IT
| 1ml | 1,112.00 € |
