CymitQuimica logo

CAS 213476-12-1

:

Lansoprazole N-Oxide

Description:
Lansoprazole N-Oxide is a chemical compound derived from lansoprazole, a proton pump inhibitor commonly used to treat conditions like gastroesophageal reflux disease (GERD) and peptic ulcers. The N-oxide form indicates that it has undergone oxidation, which can affect its pharmacological properties. This compound typically exhibits characteristics such as being a white to off-white solid, with a specific molecular structure that includes a pyridine ring and a benzimidazole moiety. Its solubility is generally in organic solvents, and it may have limited solubility in water. The N-oxide modification can influence the compound's stability, bioavailability, and metabolic pathways. In terms of safety, like many pharmaceuticals, it should be handled with care, and its effects on human health and the environment should be considered. As with any chemical substance, proper characterization through techniques such as NMR, mass spectrometry, and chromatography is essential for understanding its properties and potential applications in medicinal chemistry.
Formula:C16H14F3N3O3S
InChI:InChI=1S/C16H14F3N3O3S/c1-10-13(22(23)7-6-14(10)25-9-16(17,18)19)8-26(24)15-20-11-4-2-3-5-12(11)21-15/h2-7H,8-9H2,1H3,(H,20,21)
InChI key:OBGHBYDDJGHGNS-UHFFFAOYSA-N
SMILES:CC1=C(C=C[N+](=C1CS(=O)C2=NC3=CC=CC=C3N2)[O-])OCC(F)(F)F
Found 11 products.