CAS 2179-25-1: Methiocarb sulfone
Description:Methiocarb sulfone, with the CAS number 2179-25-1, is a chemical compound that belongs to the class of carbamate pesticides. It is primarily used as an insecticide and acaricide, effective against a variety of pests in agricultural settings. The compound is characterized by its sulfone functional group, which contributes to its chemical stability and biological activity. Methiocarb sulfone exhibits moderate toxicity to non-target organisms, including aquatic life, and thus requires careful handling and application to minimize environmental impact. Its mode of action typically involves the inhibition of acetylcholinesterase, leading to the accumulation of acetylcholine in the nervous system of pests, ultimately resulting in their paralysis and death. In terms of physical properties, methiocarb sulfone is generally a solid at room temperature, with solubility in organic solvents. Safety data sheets recommend protective measures during handling due to its potential health effects, including irritation to skin and eyes. Overall, while effective as a pesticide, its use is regulated to ensure safety for humans and the environment.
Formula:C11H15NO4S
InChI:InChI=1S/C11H15NO4S/c1-7-5-9(16-11(13)12-3)6-8(2)10(7)17(4,14)15/h5-6H,1-4H3,(H,12,13)
InChI key:InChIKey=RJBJMKAMQIOAML-UHFFFAOYSA-N
SMILES:O=C(OC=1C=C(C(=C(C1)C)S(=O)(=O)C)C)NC
- Synonyms:
- Bayer 37344 Sulfone
- Phenol, 3,5-dimethyl-4-(methylsulfonyl)-, methylcarbamate
- Phenol, 3,5-dimethyl-4-(methylsulfonyl)-, 1-(N-methylcarbamate)
- 3,5-Xylenol, 4-(methylsulfonyl)-, methylcarbamate
- Carbamic acid, methyl-, 4-(methylsulfonyl)-3,5-xylyl ester
