CymitQuimica logo

CAS 21956-47-8

:

Littorine

Description:
Littorine, with the CAS number 21956-47-8, is a chemical compound that belongs to the class of organic compounds known as alkaloids. It is primarily derived from marine organisms, particularly certain species of mollusks. Littorine is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound is known for its potential pharmacological properties, including antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry. Additionally, littorine may exhibit unique solubility and stability characteristics, influenced by its molecular configuration. Its interactions with biological systems can lead to various physiological effects, which are currently being studied for potential therapeutic applications. As with many alkaloids, littorine's safety profile and toxicity levels are important considerations in its use and study. Overall, littorine represents a fascinating area of research within the field of natural products and pharmacology.
Formula:C17H23NO3
InChI:InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)11-15(10-13)21-17(20)16(19)9-12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16-/m1/s1
InChI key:InChIKey=FNRXUEYLFZLOEZ-FXUDXRNXSA-N
SMILES:CN1[C@]2(C[C@H](OC([C@@H](CC3=CC=CC=C3)O)=O)C[C@@]1(CC2)[H])[H]
Synonyms:
  • R(-)-3α-(2-Hydroxy-3-phenylpropionyloxy)-tropane
  • Benzenepropanoic acid, α-hydroxy-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, [3(R)-endo]-
  • Benzenepropanoic acid, α-hydroxy-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, (αR)-
  • 1αH,5αH-Tropan-3α-ol, 3-phenyl-L-lactate (ester)
  • Littorine
Found 10 products.