CymitQuimica logo

CAS 55449-49-5

:

Anisodamine hydrobromide

Description:
Anisodamine hydrobromide is a chemical compound that is primarily known for its pharmacological properties. It is a quaternary ammonium derivative of anisodamine, which is an alkaloid derived from the plant Anisodus tanguticus. This substance exhibits anticholinergic effects, making it useful in various medical applications, particularly in the treatment of conditions such as bradycardia and certain types of poisoning. Anisodamine hydrobromide is characterized by its ability to inhibit the action of acetylcholine at muscarinic receptors, leading to effects such as increased heart rate and reduced secretions. The compound is typically presented as a hydrobromide salt, which enhances its solubility in water, facilitating its use in pharmaceutical formulations. Its safety profile and potential side effects are important considerations in clinical settings. As with many pharmacologically active compounds, proper dosage and administration are crucial to maximize therapeutic benefits while minimizing adverse reactions.
Formula:C17H24BrNO4
InChI:InChI=1S/C17H23NO4.BrH/c1-18-12-7-13(9-15(18)16(20)8-12)22-17(21)14(10-19)11-5-3-2-4-6-11;/h2-6,12-16,19-20H,7-10H2,1H3;1H/t12-,13-,14+,15+,16-;/m0./s1
InChI key:KMYQCELRVANQNG-YXGOVGSCSA-N
SMILES:CN1[C@H]2C[C@@H](C[C@@H]1[C@H](C2)O)OC(=O)[C@H](CO)C3=CC=CC=C3.Br
Found 11 products.