CymitQuimica logo

CAS 229625-50-7

:

Phosphoric acid, chloromethyl bis(1,1-dimethylethyl) ester

Description:
Phosphoric acid, chloromethyl bis(1,1-dimethylethyl) ester, with the CAS number 229625-50-7, is an organophosphorus compound characterized by the presence of a phosphoric acid moiety esterified with chloromethyl and bis(1,1-dimethylethyl) groups. This compound typically exhibits properties associated with phosphoric acid esters, such as being a colorless to pale yellow liquid with a characteristic odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic alkyl groups. The chloromethyl group may impart reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of other chemical compounds. Additionally, the presence of the bulky tert-butyl groups can influence its steric properties and reactivity. Safety considerations should be taken into account, as organophosphorus compounds can exhibit toxicity, and appropriate handling procedures should be followed. Overall, this compound's unique structure and properties make it of interest in both industrial and research contexts.
Formula:C9H20ClO4P
InChI:InChI=1S/C9H20ClO4P/c1-8(2,3)13-15(11,12-7-10)14-9(4,5)6/h7H2,1-6H3
InChI key:LNJAJHJFSKUCIR-UHFFFAOYSA-N
SMILES:CC(C)(C)OP(=O)(OCCl)OC(C)(C)C
Found 6 products.