CAS 23094-71-5: Chebulagic acid
Description:Chebulagic acid is a naturally occurring polyphenolic compound primarily found in the fruit of the Terminalia chebula tree, which is commonly used in traditional medicine. It is classified as a tannin and is known for its antioxidant properties, contributing to its potential health benefits. The chemical structure of chebulagic acid features multiple hydroxyl groups, which enhance its ability to scavenge free radicals and exhibit anti-inflammatory effects. This compound has garnered interest for its potential therapeutic applications, including its role in promoting digestive health and its possible anticancer properties. Additionally, chebulagic acid may influence various biochemical pathways, making it a subject of research in pharmacology and nutraceuticals. Its solubility in water and organic solvents varies, which can affect its bioavailability and efficacy in different formulations. Overall, chebulagic acid represents a significant area of study in natural product chemistry and its implications for health and wellness.
Formula:C41H30O27
InChI:InChI=1S/C41H30O27/c42-13-1-8(2-14(43)24(13)49)35(56)68-41-34-33-31(64-39(60)12(6-19(47)48)22-23-11(38(59)67-34)5-17(46)27(52)32(23)65-40(61)30(22)55)18(63-41)7-62-36(57)9-3-15(44)25(50)28(53)20(9)21-10(37(58)66-33)4-16(45)26(51)29(21)54/h1-5,12,18,22,30-31,33-34,41-46,49-55H,6-7H2,(H,47,48)
InChI key:InChIKey=HGJXAVROWQLCTP-UHFFFAOYSA-N
SMILES:O=C(O)CC1C(=O)OC2C3OC(OC(=O)C4=CC(O)=C(O)C(O)=C4)C(OC(=O)C5=CC(O)=C(O)C=6OC(=O)C(O)C1C65)C2OC(=O)C7=CC(O)=C(O)C(O)=C7C=8C(O)=C(O)C(O)=CC8C(=O)OC3
- Synonyms:
- 10,24-(Epoxymethano)-11H-dibenzo[8,9:10,11][1,6]dioxacyclododecino[2,3-d]pyrano[4,3,2-ij][2,6]benzodioxacycloundecin, β-D-glucopyranose deriv.
- Chebulagic acid
- β-D-Glucopyranose, cyclic 3,6-[(1R)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate] 1-(3,4,5-trihydroxybenzoate), cyclic 2→5:4→1-ester with (2S)-[(3S,4S)-5-carboxy-3,4-dihydro-3,7,8-trihydroxy-2-oxo-2H-1-benzopyran-4-yl]butanedioic acid
- β-D-Glucopyranose, cyclic 3,6-[(1R)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate] 1-(3,4,5-trihydroxybenzoate), cyclic 2→2:4→1-ester with (2S)-[(3S,4S)-5-carboxy-3,4-dihydro-3,7,8-trihydroxy-2-oxo-2H-1-benzopyran-4-yl]butanedioic acid
- β-D-Glucopyranose, cyclic 3,6-[(1R)-4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate] 1-(3,4,5-trihydroxybenzoate), cyclic 2→2:4→1-ester with (2S)-2-[(3S,4S)-5-carboxy-3,4-dihydro-3,7,8-trihydroxy-2-oxo-2H-1-benzopyran-4-yl]butanedioic acid
