CymitQuimica logo

CAS 245329-02-6

:

L-Tyrosinamide, L-phenylalanyl-L-seryl-L-leucyl-L-leucyl-L-arginyl-

Description:
L-Tyrosinamide, L-phenylalanyl-L-seryl-L-leucyl-L-leucyl-L-arginyl- is a peptide compound characterized by its specific sequence of amino acids, which includes tyrosine, phenylalanine, serine, leucine, and arginine. This compound is likely to exhibit properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of polar side chains. The presence of aromatic amino acids like tyrosine and phenylalanine may contribute to its hydrophobic characteristics, while the basic side chain of arginine can impart positive charge under physiological conditions. Peptides like this one often play roles in biological processes, including signaling and enzyme activity. Additionally, the specific arrangement of amino acids can influence the compound's three-dimensional structure, stability, and interactions with other biomolecules. As a synthetic or naturally occurring peptide, it may have potential applications in pharmaceuticals or biochemistry, although further research would be necessary to elucidate its specific functions and therapeutic potential.
Formula:C39H60N10O8
InChI:InChI=1S/C39H60N10O8/c1-22(2)17-30(36(55)45-28(11-8-16-44-39(42)43)35(54)46-29(33(41)52)20-25-12-14-26(51)15-13-25)47-37(56)31(18-23(3)4)48-38(57)32(21-50)49-34(53)27(40)19-24-9-6-5-7-10-24/h5-7,9-10,12-15,22-23,27-32,50-51H,8,11,16-21,40H2,1-4H3,(H2,41,52)(H,45,55)(H,46,54)(H,47,56)(H,48,57)(H,49,53)(H4,42,43,44)/t27-,28-,29-,30-,31-,32-/m0/s1
InChI key:KMSCNWHRNILNRJ-JNRWAQIZSA-N
SMILES:CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CC2=CC=CC=C2)N
Found 6 products.