CAS 2503-26-6

(3S,6S,9S,16S,21aS)-3-[(2S)-butan-2-yl]-5,8,9-trimethyl-16-(2-methylpropyl)-6-(propan-2-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone

Description:

The chemical substance with the name "(3S,6S,9S,16S,21aS)-3-[(2S)-butan-2-yl]-5,8,9-trimethyl-16-(2-methylpropyl)-6-(propan-2-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone" and CAS number "2503-26-6" is a complex organic compound characterized by a multi-ring structure that includes both nitrogen and oxygen atoms. This compound features multiple stereocenters, indicating that it exists in various stereoisomeric forms, which can significantly influence its biological activity and chemical reactivity. The presence of alkyl substituents suggests potential hydrophobic interactions, while the oxapentaazacyclononadecine framework indicates a unique cyclic arrangement that may contribute to its stability and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. The intricate structure may also imply specific interactions with biological targets, making it a candidate for further research in drug development or as a biochemical probe.

Formula: C₃₀H₅₁N₅O₇

InChI: InChI=1/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38)/t19-,20-,21-,22-,24-,25-/m0/s1

SMILES: CC[C@H](C)[C@H]1C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](C)C(=NCCC(=O)O[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=N1)O)O

Cyclo[N-methyl-L-alanyl-β-alanyl-(2R)-2-hydroxy-4-methylpentanoyl-L-prolyl-L-isoleucyl-N-methyl-L-valyl]

CAS: 2503-26-6

Formula: C₃₀H₅₁N₅O₇

Molecular weight: 593.7552

Ref: IN-DA002Q88

Destruxin B from Metarhizium anisopliae

CAS: 2503-26-6

Destruxin B from Metarhizium anisopliae

Molecular weight: 593.76g/mol

Ref: 54-BID1012

Destruxin B

CAS: 2503-26-6

Destruxin B: cyclic peptide from Metarhizium fungus, induces apoptosis in lung cancer via mitochondrial pathway.

Formula: C₃₀H₅₁N₅O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 593.766

Ref: TM-T11009

Destruxin B

Controlled Product

CAS: 2503-26-6

Formula: C₃₀H₅₁N₅O₇

Color and Shape: Neat

Molecular weight: 593.755

Ref: TR-D370930

Destruxin B

CAS: 2503-26-6

Destruxin B is a mycotoxin, which is a secondary metabolite derived from the fungus *Metarhizium anisopliae*. This compound acts as an insecticidal agent by disrupting calcium homeostasis in target insects, leading to paralysis and eventually death.

Purity: Min. 95%

Ref: 3D-BD162718