CAS 2503-26-6: (3S,6S,9S,16S,21aS)-3-[(2S)-butan-2-yl]-5,8,9-trimethyl-16-(2-methylpropyl)-6-(propan-2-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone
Description:The chemical substance with the name "(3S,6S,9S,16S,21aS)-3-[(2S)-butan-2-yl]-5,8,9-trimethyl-16-(2-methylpropyl)-6-(propan-2-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone" and CAS number "2503-26-6" is a complex organic compound characterized by a multi-ring structure that includes both nitrogen and oxygen atoms. This compound features multiple stereocenters, indicating that it exists in various stereoisomeric forms, which can significantly influence its biological activity and chemical reactivity. The presence of alkyl substituents suggests potential hydrophobic interactions, while the oxapentaazacyclononadecine framework indicates a unique cyclic arrangement that may contribute to its stability and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. The intricate structure may also imply specific interactions with biological targets, making it a candidate for further research in drug development or as a biochemical probe.
Formula:C30H51N5O7
InChI:InChI=1/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38)/t19-,20-,21-,22-,24-,25-/m0/s1