CAS 2503-26-6

(3S,6S,9S,16S,21aS)-3-[(2S)-butan-2-yl]-5,8,9-trimethyl-16-(2-methylpropyl)-6-(propan-2-yl)dodecahydropyrrolo[1,2-d][1,4,7,10,13,16]oxapentaazacyclononadecine-1,4,7,10,14,17(11H,16H)-hexone

Formula: C₃₀H₅₁N₅O₇

InChI: InChI=1/C30H51N5O7/c1-10-19(6)24-29(40)34(9)25(18(4)5)30(41)33(8)20(7)26(37)31-14-13-23(36)42-22(16-17(2)3)28(39)35-15-11-12-21(35)27(38)32-24/h17-22,24-25H,10-16H2,1-9H3,(H,31,37)(H,32,38)/t19-,20-,21-,22-,24-,25-/m0/s1

InChI key: GNBHVMBELHWUIF-VTSYCQLTSA-N

SMILES: CC[C@H](C)[C@H]1C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](C)C(=NCCC(=O)O[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=N1)O)O

Destruxin B from Metarhizium anisopliae

CAS: 2503-26-6

Destruxin B from Metarhizium anisopliae

Formula: C₃₀H₅₁N₅O₇

Color and Shape: Solid-Powder

Molecular weight: 593.75523

Ref: 54-BID1012

Destruxin B

CAS: 2503-26-6

Destruxin B: cyclic peptide from Metarhizium fungus, induces apoptosis in lung cancer via mitochondrial pathway.

Formula: C₃₂H₅₅N₅O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 621.8084

Ref: TM-T11009

Destruxin B

CAS: 2503-26-6

Formula: C₃₀H₅₁N₅O₇

Purity: 99%

Color and Shape: Solid

Molecular weight: 593.7552

Ref: IN-DA002Q88

Destruxin B

Controlled Product

CAS: 2503-26-6

Formula: C₃₀H₅₁N₅O₇

Color and Shape: Neat

Molecular weight: 593.755

Ref: TR-D370930

Destruxin B

CAS: 2503-26-6

Destruxin B is a mycotoxin, which is a secondary metabolite derived from the fungus *Metarhizium anisopliae*. This compound acts as an insecticidal agent by disrupting calcium homeostasis in target insects, leading to paralysis and eventually death.

Purity: Min. 95%

Ref: 3D-BD162718