CymitQuimica logo

CAS 251326-99-5

:

2-Cyclopentene-1-carboxylic acid,4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, (1R,4S)-

Description:
2-Cyclopentene-1-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, with the CAS number 251326-99-5, is a chemical compound characterized by its unique structural features. It contains a cyclopentene ring, which contributes to its cyclic and unsaturated nature, and a carboxylic acid functional group that imparts acidic properties. The presence of the dimethylethoxycarbonyl group indicates that it has protective or modifying functionalities, often used in organic synthesis to enhance stability or solubility. As a methyl ester, it exhibits ester characteristics, which can influence its reactivity and interactions in various chemical environments. The stereochemistry, indicated by the (1R,4S) configuration, suggests specific spatial arrangements of atoms that can affect the compound's biological activity and reactivity. Overall, this compound may be of interest in synthetic organic chemistry, pharmaceuticals, or materials science due to its structural complexity and potential applications.
Formula:C12H19NO4
InChI:InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-9-6-5-8(7-9)10(14)16-4/h5-6,8-9H,7H2,1-4H3,(H,13,15)/t8-,9+/m0/s1
InChI key:HKLDTKMTZPXEAZ-DTWKUNHWSA-N
SMILES:CC(C)(C)OC(=O)N[C@H]1C[C@H](C=C1)C(=O)OC
Found 6 products.