CymitQuimica logo

CAS 25999-13-7

:

2-Propenamide, N-propyl-

Description:
2-Propenamide, N-propyl- is an organic compound characterized by its amide functional group attached to a propyl chain and a propenyl group. It is a colorless to pale yellow liquid with a characteristic odor. This compound is soluble in water and organic solvents, which makes it versatile for various applications in chemical synthesis and industrial processes. The presence of the propenamide structure allows for potential reactivity in polymerization and other chemical reactions, making it useful in the production of polymers and as a monomer in various formulations. Additionally, it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its physical and chemical behavior. Safety considerations should be taken into account, as with many organic compounds, including proper handling and storage to avoid exposure. Overall, 2-Propenamide, N-propyl- is a significant compound in organic chemistry with potential applications in materials science and chemical manufacturing.
Formula:C6H11NO
InChI:InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h4H,2-3,5H2,1H3,(H,7,8)
InChI key:WDFKEEALECCKTJ-UHFFFAOYSA-N
SMILES:CCCNC(=O)C=C
Found 6 products.