CAS 2808-39-1
:1-hydroxy-6,6,9-trimethyl-3-pentyl-6H-benzo[c]chromene-2-carboxylic acid
Description:
1-Hydroxy-6,6,9-trimethyl-3-pentyl-6H-benzo[c]chromene-2-carboxylic acid, with the CAS number 2808-39-1, is a chemical compound that belongs to the class of benzochromenes, which are characterized by their fused benzene and chromene rings. This compound features a hydroxyl group and a carboxylic acid functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of multiple methyl groups and a pentyl chain suggests that it may exhibit hydrophobic properties, influencing its behavior in biological systems and its interaction with lipid membranes. The structural complexity of this compound may also impart unique pharmacological properties, making it of interest in medicinal chemistry and natural product research. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets and its stability under various conditions. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various fields, including pharmaceuticals and materials science.
Formula:C22H26O4
InChI:InChI=1/C22H26O4/c1-5-6-7-8-14-12-17-19(20(23)18(14)21(24)25)15-11-13(2)9-10-16(15)22(3,4)26-17/h9-12,23H,5-8H2,1-4H3,(H,24,25)
SMILES:CCCCCc1cc2c(c3cc(C)ccc3C(C)(C)O2)c(c1C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cannabinolic acid (CBNA) 100 µg/mL in Methanol
CAS:Controlled ProductFormula:C22H26O4Color and Shape:Single SolutionMolecular weight:354.44Cannabinolic acid (CBNA) 1000 µg/mL in Methanol
CAS:Controlled ProductFormula:C22H26O4Color and Shape:Single SolutionMolecular weight:354.44Cannabinoids Acids Mixture 212 1000 µg/mL in Acetonitrile
CAS:Controlled ProductColor and Shape:ColourlessCannabinolic Acid
CAS:Controlled ProductCannabinolic acid is a non-psychoactive cannabinoid derived from tetrahydrocannabinolic acid1. In vitro, cannabinolic acid has been observed to have heterogeneous anti-tumorigenic properties on a variety of cancer cell lines, with particular potency affecting the survival of prostate carcinoma-derived cell lines1,2.Formula:C22H26O4Purity:Min. 95%Molecular weight:354.44 g/mol


