CAS 31932-13-5
:Benzoic acid,2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-6-propyl-
Description:
The chemical substance known as 2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-6-propylbenzoic acid, with the CAS number 31932-13-5, is a complex organic compound characterized by its aromatic structure and multiple functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts and esters. The presence of hydroxyl (-OH) groups indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The cyclohexene ring and the isoprenyl substituent suggest that it may exhibit unique stereochemical properties and biological activity. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in medicinal chemistry or as a plant growth regulator. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would require further investigation through experimental data or literature sources.
Formula:C20H26O4
InChI:InChI=1S/C20H26O4/c1-5-6-13-10-16(21)18(19(22)17(13)20(23)24)15-9-12(4)7-8-14(15)11(2)3/h9-10,14-15,21-22H,2,5-8H2,1,3-4H3,(H,23,24)/t14-,15+/m0/s1
InChI key:CZXWOKHVLNYAHI-LSDHHAIUSA-N
SMILES:CCCC1=CC(=C(C(=C1C(=O)O)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O
Synonyms:- Benzoicacid, 2,4-dihydroxy-3-[3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-6-propyl-,(1R-trans)-
- b-Resorcylicacid, 3-p-mentha-1,8-dien-3-yl-6-propyl- (8CI)
- Cannabidivaric acid
- Cannabidivarinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Cannabidivarinic acid (CBDVA) 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C20H26O4Color and Shape:Single SolutionMolecular weight:330.42Cannabinoids Acids Mixture 196 1000 µg/mL in Acetonitrile
CAS:Controlled ProductColor and Shape:MixtureCannabidivarinic acid (CBDVA) 1000 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C20H26O4Color and Shape:Single SolutionMolecular weight:330.42Cannabinoids Acids Mixture 212 1000 µg/mL in Acetonitrile
CAS:Controlled ProductColor and Shape:MixtureCannabidivarinic acid
CAS:Cannabidivarinic acid (CBDVA), the carboxylic acid precursor to cannabidivarin (CBDV), is a non-psychoactive cannabinoid found in Cannabis and known for its anti-inflammatory properties.Formula:C20H26O4Color and Shape:SolidMolecular weight:330.42Cannabidivarinic acid
CAS:Controlled ProductCannabidivarinic acid is a non-psychoactive phytocannabinoid and a derivate of cannabidivarin1. No in vitro or in vivo pharmacological and toxicological studies have been conducted on cannabidivarininic acid, but due to its molecular similarity to cannabidivarin, it is thought to prevent nausea and act as an anticonvulsant in vivo.Purity:Min. 95%Molecular weight:330.42 g/molCannabinoids Acids Mixture 184 1000 µg/mL in Acetonitrile
CAS:Controlled ProductColor and Shape:Colourless





