CymitQuimica logo

CAS 28788-42-3

:

Decahydronaphthalene-d18

Description:
Decahydronaphthalene-d18, also known as deuterated decahydronaphthalene, is a deuterated form of decahydronaphthalene, a bicyclic hydrocarbon. Its molecular formula is C10H18, but in this deuterated version, hydrogen atoms are replaced by deuterium, resulting in a formula of C10D18. This compound is characterized by its colorless liquid state at room temperature and has a relatively high boiling point compared to its non-deuterated counterpart. Decahydronaphthalene-d18 is primarily used in research applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuteration helps to reduce background signals and improve the clarity of spectral data. The presence of deuterium also allows for the study of reaction mechanisms and dynamics in various chemical processes. Additionally, it is important in the field of organic chemistry and materials science for its role as a solvent and in the synthesis of other chemical compounds. As with many deuterated compounds, it is handled with care due to its specific isotopic labeling and potential applications in advanced research.
Formula:C10D18
InChI:InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D
InChI key:NNBZCPXTIHJBJL-XRRAJICISA-N
SMILES:C1(C(C(C2(C(C(C(C(C2(C1([2H])[2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]
Synonyms:
  • Decahydronapthalene-d18
  • (~2~H_18_)decahydronaphthalene
Found 2 products.