CAS 288383-20-0
:Cediranib
Description:
Cediranib, with the CAS number 288383-20-0, is a small molecule inhibitor primarily known for its role as a potent and selective inhibitor of vascular endothelial growth factor receptor (VEGFR) tyrosine kinases. It is classified as an anti-cancer agent, particularly in the treatment of various solid tumors, including non-small cell lung cancer and ovarian cancer. Cediranib exhibits characteristics such as a relatively low molecular weight and a specific chemical structure that allows it to effectively block angiogenesis, the process through which new blood vessels form from pre-existing ones, which is crucial for tumor growth and metastasis. The compound is typically administered orally and has been studied in clinical trials for its efficacy and safety profile. Its mechanism of action involves the inhibition of VEGF signaling pathways, leading to reduced tumor vascularization and growth. As with many targeted therapies, potential side effects may include hypertension, fatigue, and gastrointestinal disturbances, necessitating careful monitoring during treatment.
Formula:C25H27FN4O3
InChI:InChI=1S/C25H27FN4O3/c1-16-12-17-19(29-16)6-7-21(24(17)26)33-25-18-13-22(31-2)23(14-20(18)27-15-28-25)32-11-5-10-30-8-3-4-9-30/h6-7,12-15,29H,3-5,8-11H2,1-2H3
InChI key:InChIKey=XXJWYDDUDKYVKI-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=C(OCCCN3CCCC3)C(OC)=C2)N=CN1)C=4C(F)=C5C(=CC4)NC(C)=C5
Synonyms:- 4-(4-Fluoro-2-methylindol-5-yloxy)-6-methoxy-7-[3-(pyrrolidin-1-yl)propoxy]quinazoline
- 4-[(4-Fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-(1-pyrrolidinyl)propoxy]quinazoline
- 4-[(4-Fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-(pyrrolidin-1-yl)propoxy]quinazoline
- 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazoline
- Azd 2171
- Azd2171
- Quinazoline, 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-(1-pyrrolidinyl)propoxy]-
- Zd 2171
- Cediranib
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-(pyrrolidin-1-yl)propoxy]quinazoline
CAS:Formula:C25H27FN4O3Purity:97%Color and Shape:SolidMolecular weight:450.5053Cediranib
CAS:Formula:C25H27FN4O3Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:450.51Cediranib
CAS:Cediranib (AZD2171) is a potent KDR tyrosine kinase inhibitor (IC50 < 1nM), also targets Flt1/4, PDGFRβ, c-Kit, and more selective for VEGFR.Formula:C25H27FN4O3Purity:97.21% - 99.94%Color and Shape:SolidMolecular weight:450.51Ref: TM-T2500
2mg39.00€5mg59.00€10mg87.00€25mg129.00€50mg168.00€100mg240.00€200mg439.00€500mg703.00€1mL*10mM (DMSO)65.00€Cediranib
CAS:CediranibFormula:C25H27FN4O3Purity:99.82% (Typical Value in Batch COA)Color and Shape: off-white solidMolecular weight:450.51g/molCediranib
CAS:Inhibitor of VEGF receptor tyrosine kinases and non-receptor tyrosine kinases
Formula:C25H27FN4O3Purity:Min. 98 Area-%Color and Shape:White To Off-White SolidMolecular weight:450.20672Cediranib
CAS:Controlled ProductApplications Cediranib is a drug for blocking angiogenesis, study on cervical cancer molecular targeted drug and clinical application progress, value of correlative biomakers in the understanding of tumor biology.
References Shao, J., et al.: Shiyong Yixue Zazhi, 31, 4143 (2015); Gerstner, E. R., et al.: Transl. Cancer Res., 5, 211 (2016)Formula:C25H27FN4O3Color and Shape:NeatMolecular weight:450.51







