CymitQuimica logo

CAS 292135-78-5

:

Benzamide,3-(cyclopropylmethoxy)-N-(3,5-dichloro-1-oxido-4-pyridinyl)-4-(difluoromethoxy)-

Description:
Benzamide, 3-(cyclopropylmethoxy)-N-(3,5-dichloro-1-oxido-4-pyridinyl)-4-(difluoromethoxy)- is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with various functional groups. The presence of a cyclopropylmethoxy group suggests potential steric effects and unique reactivity due to the cyclic structure. The dichloro and difluoromethoxy substituents indicate the compound may exhibit significant electronic properties, potentially influencing its biological activity and solubility. The pyridine ring contributes to the compound's aromatic character and may enhance its interaction with biological targets. This compound is likely to be of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its specific properties, such as melting point, solubility, and reactivity, would depend on the overall molecular interactions and the presence of the various substituents. As with many compounds of this nature, further studies would be necessary to fully elucidate its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C17H14Cl2F2N2O4
InChI:InChI=1S/C17H14Cl2F2N2O4/c18-11-6-23(25)7-12(19)15(11)22-16(24)10-3-4-13(27-17(20)21)14(5-10)26-8-9-1-2-9/h3-7,9,17,25H,1-2,8H2
InChI key:KHXXMSARUQULRI-UHFFFAOYSA-N
SMILES:C1CC1COC2=C(C=CC(=C2)C(=O)N=C3C(=CN(C=C3Cl)O)Cl)OC(F)F
Synonyms:
  • RofluMilast N-Oxide
Found 14 products.