CAS 31282-04-9
:Hygromycin B
Description:
Hygromycin B is an aminoglycoside antibiotic produced by the bacterium *Micromonospora hygroscopicus*. It is primarily known for its ability to inhibit protein synthesis in bacteria and some eukaryotic cells, making it a valuable tool in molecular biology for selecting genetically modified organisms. Hygromycin B is effective against a broad spectrum of microorganisms, including certain Gram-positive and Gram-negative bacteria, as well as fungi. Its mechanism of action involves binding to the ribosomal RNA, disrupting the translation process. The compound is typically used in laboratory settings for the selection of cells that have been transformed with hygromycin resistance genes. Hygromycin B is soluble in water and exhibits stability under various pH conditions, although it is sensitive to light and should be stored in a dark environment. Safety precautions are necessary when handling this compound, as it can be toxic to humans and other organisms at high concentrations. Overall, Hygromycin B is a crucial reagent in genetic engineering and cell biology research.
Formula:C20H37N3O13
InChI:InChI=1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6+,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20?/m1/s1
InChI key:InChIKey=GRRNUXAQVGOGFE-HUCHGKBZSA-N
SMILES:O[C@H]1C2(O[C@]3([C@@](O2)([C@@H](O)[C@@H](CO)O[C@H]3O[C@H]4[C@H](O)[C@@H](NC)C[C@@H](N)[C@@H]4O)[H])[H])O[C@]([C@H](CO)N)([C@H](O)[C@@H]1O)[H]
Synonyms:- (3'R,3aS,4S,4'R,5'R,6R,6'R,7S,7aS)-4-{[(1R,2S,3R,5S,6R)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol (non-preferred name)
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-6-amino-6-deoxy-<smallcap>L</smallcap>-glycero-<smallcap>D</smallcap>-galacto-heptopyranosylidene-(1→2-3)-O-β-<smallcap>D</span>-talopyranosyl-(1→5)-2-deoxy-N<sup>3</sup>-methyl-
- Antihelmycin
- Hygromix 2.4
- Hygromix-8
- Hygromycin B
- Hygromycin B - Solution
- Hygromycin B Streptomyces hygroscopicus
- Hygromycin B solution Streptomyces hygroscopicus
- Hygrovetin
- Hygrovetine
- O-6-Amino-6-deoxy-<span class="text-smallcaps">L</smallcap>-glycero-<smallcap>D</smallcap>-galacto-heptopyranosylidene-(1→2-3)-O-β-<smallcap>D</smallcap>-talopyranosyl-(1→5)-2-deoxy-N<sup>3</sup>-methyl-<smallcap>D</span>-streptamine
- hygromycin B aqueous solution
- hygromycin B from streptomyces*hygroscopicus
- hygromycin B plant cell culture tested
- D-Streptamine, O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1→2-3)-O-β-D-talopyranosyl-(1→5)-2-deoxy-N3-methyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 18 products.
Hygromycin B
CAS:Formula:C20H37N3O13Purity:>80.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:527.52Hygromycin B
CAS:<p>Hygromycin B, 31282-04-9, is an aminoglycoside antibiotic which exhibits activity against eukaryotic and prokaryotic cells through inhibition of protein synthesis. Learn more.</p>Formula:C20H37N3O13Color and Shape:Cream to plale brown, PowderMolecular weight:527.52Hygromycin B, 50 mg/ml in distilled water, sterile-filtered
CAS:<p>Hygromycin B, 50mg/mL in distilled water, sterile-filtered</p>Formula:C20H37N3O13Color and Shape:Liquid, Pale yellow to brownMolecular weight:527.52Hygromycin B
CAS:<p>Hygromycin B disrupts protein synthesis in 70S ribosomes, used as an anthelmintic in swine.</p>Formula:C20H37N3O13Purity:98% - 99.78%Color and Shape:solidMolecular weight:527.52Hygromycin B
CAS:Formula:C20H37N3O13Purity:≥ 90.0%Color and Shape:White to beige powderMolecular weight:527.53Hygromycin B, PBS solution
CAS:<p>Hygromycin B, PBS solution</p>Formula:C20H37N3O13Purity:(hplc) min. 90.0% 91.5% (Typical Value in Batch COA)Color and Shape:LiquidMolecular weight:527.52g/molHygromycin B, powder
CAS:<p>Hygromycin B, powder</p>Formula:C20H37N3O13Purity:By hplc: 99.4% (Typical Value in Batch COA)Color and Shape: light tan powderMolecular weight:527.52g/molHygromycin B Deuterated (d4 major)
CAS:Controlled ProductFormula:C20H33D4N3O13Color and Shape:NeatMolecular weight:531.54Hygromycin B
CAS:<p>Hygromycin B binds near the A site of 16S rRNA and induces errors in the code by inhibition of translocation of peptydil-tRNA, however to a lesser extent compared to other aminoglycosides. Hygromycin B is efficient against bacteria, fungi and other eukaryotic cells, but more often used for the selection of eukaryotic cells including yeasts, such as, P. pastoris and S. cerevisiae, and mammalian cell lines, such as, CHO.</p>Formula:C20H37N3O13Purity:Min. 95%Color and Shape:White PowderMolecular weight:527.52 g/molHygromycin B - min 90%
CAS:<p>Inhibitor of protein synthesis; aminoglycoside</p>Formula:C20H37N3O13Purity:Min. 90 Area-%Color and Shape:PowderMolecular weight:527.52 g/molHygromycin B
CAS:Controlled Product<p>Applications Hygromycin B is an aminoglycoside and a selective antibiotic agent for the hph gene. Hygromycin B inhibits protein synthesis by interfering with translocation and causing mistranslation at the 70S ribosome<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Cha, T.S., et al.: World. J. Microbiol. Biotechnol., 28, 1771 (2012); Herrero, L., et al.: Biochem., 52, 171 (2013);<br></p>Formula:C20H37N3O13Color and Shape:Off-WhiteMolecular weight:527.52Hygromycin B (HGR), 90%
CAS:Formula:C20H37N3O13Purity:min. 90%Color and Shape:White to off - white, PowderMolecular weight:527.52Hygromycin B (HGR) for tissue culture, 90%
CAS:Formula:C20H37N3O13Purity:min. 90%Color and Shape:White to off white, PowderMolecular weight:527.52Hygromycin B (HGR Solution), 50mg/ml in Aq. Solution
CAS:Formula:C20H37N3O13Color and Shape:Light yellow to very dark yellow to brown-yellow or light orange to very dark orange, Liquid, Clear to slight hazyMolecular weight:527.52
