CymitQuimica logo

CAS 33830-10-3

:

1-Adamantan-D15-amine

Description:
1-Adamantan-D15-amine, with the CAS number 33830-10-3, is a deuterated derivative of adamantanamine, which is a cyclic amine featuring a diamond-like structure. The presence of deuterium (D) in its molecular structure indicates that hydrogen atoms have been replaced with deuterium isotopes, enhancing its stability and altering its physical properties. This compound is characterized by its unique three-dimensional structure, which contributes to its potential applications in medicinal chemistry and as a tracer in various chemical reactions. The deuteration can improve the compound's solubility and metabolic stability, making it useful in studies involving drug metabolism and pharmacokinetics. Additionally, 1-Adamantan-D15-amine may exhibit distinct spectroscopic properties due to the presence of deuterium, which can be advantageous in NMR spectroscopy and other analytical techniques. Overall, this compound serves as a valuable tool in both research and industrial applications, particularly in the fields of organic synthesis and pharmaceutical development.
Formula:C10H2D15N
InChI:InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D,8D,9D
InChI key:DKNWSYNQZKUICI-BXSQCBKHSA-N
SMILES:[2H]C1(C2(C(C3(C(C1(C(C(C2([2H])[2H])(C3([2H])[2H])N)([2H])[2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H])[2H]
Found 9 products.