CAS 34202-69-2
:Hexafluoroacetone trihydrate
Description:
Hexafluoroacetone trihydrate is a chemical compound characterized by its unique structure and properties. It is a hydrate form of hexafluoroacetone, which is a colorless, volatile liquid with a pungent odor. The trihydrate form indicates that three water molecules are associated with each molecule of hexafluoroacetone, influencing its physical state and solubility. This compound is known for its strong electrophilic nature due to the presence of highly electronegative fluorine atoms, making it a useful reagent in various chemical reactions, particularly in organic synthesis and fluorination processes. Hexafluoroacetone trihydrate is also notable for its stability under certain conditions, although it can be reactive with nucleophiles. Safety precautions are essential when handling this substance, as it can be hazardous, exhibiting potential toxicity and environmental concerns. Its applications extend to fields such as pharmaceuticals, agrochemicals, and materials science, where it serves as an intermediate or catalyst in the synthesis of more complex molecules.
Formula:C3F6O·3H2O
InChI:InChI=1S/C3F6O.3H2O/c4-2(5,6)1(10)3(7,8)9;;;/h;3*1H2
InChI key:InChIKey=SNZAEUWCEHDROX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)=O.O
Synonyms:- 1,1,1,3,3,3-Hexafluoropropan-2-One Trihydrate
- 2-Propanone, 1,1,1,3,3,3-hexafluoro-, hydrate (1:3)
- 2-Propanone, 1,1,1,3,3,3-hexafluoro-, trihydrate
- Hexafluoro acetone trihydrate
- Hexafluoro-2-propanone trihydrate
- Hfa・3H2O
- Perfluoroacetone trihydrate
- Hexafluoroacetone trihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Hexafluoroacetone Hydrate
CAS:Formula:C3F6O·xH2OPurity:>97.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:166.02 (as Anhydrous)Hexafluoroacetone trihydrate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C3H6F6O4Purity:98%Color and Shape:Liquid, Clear colorlessMolecular weight:220.07Hexafluoroacetone trihydrate, min. 97%
CAS:Hexafluoroacetone trihydrate, min. 97%
Formula:CF3COCF3·3H2OPurity:min. 97%Color and Shape:colorless liq.Molecular weight:166.02 (220.07)Perfluoroacetone trihydrate
CAS:Perfluoroacetone trihydrateFormula:C3F6O·3H2OPurity:95%Color and Shape:Colourless LiquidMolecular weight:220.06775Hexafluoroacetone Trihydrate
CAS:Formula:C3H6F6O4Purity:98%Color and Shape:LiquidMolecular weight:220.0678Hexafluoroacetone Trihydrate
CAS:Controlled ProductFormula:C3F6O·3H2OColor and Shape:NeatMolecular weight:220.07Hexafluoroacetone trihydrate
CAS:Formula:C3H6F6O4Purity:95%Color and Shape:Liquid, Clear colourless liquidMolecular weight:220.067







