CymitQuimica logo

CAS 402960-38-7

:

2-Aminopyrimidine-5-boronic acid pinacol ester

Description:
2-Aminopyrimidine-5-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is known for its ability to form reversible covalent bonds with diols and is often utilized in various organic synthesis applications. This compound features a pyrimidine ring, which contributes to its aromatic properties and potential biological activity. The presence of the amino group enhances its reactivity and solubility in polar solvents, making it suitable for various chemical reactions, including Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The pinacol ester moiety provides stability and can facilitate the handling and storage of the boronic acid derivative. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and the synthesis of complex organic molecules. As with many boronic acids, it may exhibit sensitivity to moisture and air, necessitating careful storage conditions to maintain its integrity and reactivity.
Formula:C10H16BN3O2
InChI:InChI:1S/C10H16BN3O2/c1-9(2)10(3,4)16-11(15-9)7-5-13-8(12)14-6-7/h5-6H,1-4H3,(H2,12,13,14)
InChI key:BPQVMIDUTRJYSC-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N
Synonyms:
  • 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine
  • 5-(Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyrimidin-2-Amine
  • 2-Aminopyrimidine-5-Boronic Acid, Pinacol Ester
Found 8 products.