CAS 404844-02-6: N-{4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl}-4-(piperazin-1-ylmethyl)benzamide
Description:N-{4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl}-4-(piperazin-1-ylmethyl)benzamide is a complex organic compound characterized by its multi-functional structure, which includes a benzamide core, a piperazine moiety, and a pyrimidine-pyridine linkage. This compound typically exhibits properties such as moderate to high solubility in polar solvents, which is common for many amide derivatives. Its molecular structure suggests potential biological activity, particularly in medicinal chemistry, where such compounds are often explored for their roles as enzyme inhibitors or receptor modulators. The presence of multiple aromatic rings may contribute to its ability to interact with biological targets through π-π stacking and hydrogen bonding. Additionally, the piperazine ring can enhance the compound's pharmacokinetic properties, such as absorption and distribution. Overall, this compound's unique structural features make it a candidate for further research in drug development and therapeutic applications.
Formula:C28H29N7O
InChI:InChI=1/C28H29N7O/c1-20-4-9-24(17-26(20)34-28-31-12-10-25(33-28)23-3-2-11-30-18-23)32-27(36)22-7-5-21(6-8-22)19-35-15-13-29-14-16-35/h2-12,17-18,29H,13-16,19H2,1H3,(H,32,36)(H,31,33,34)
- Synonyms:
- N-Desmethyl Imatinib
- N-Desmethyl gleevec