CAS 404844-02-6
:N-{4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl}-4-(piperazin-1-ylmethyl)benzamide
Description:
N-{4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl}-4-(piperazin-1-ylmethyl)benzamide is a complex organic compound characterized by its multi-functional structure, which includes a benzamide core, a piperazine moiety, and a pyrimidine-pyridine linkage. This compound typically exhibits properties such as moderate to high solubility in polar solvents, which is common for many amide derivatives. Its molecular structure suggests potential biological activity, particularly in medicinal chemistry, where such compounds are often explored for their roles as enzyme inhibitors or receptor modulators. The presence of multiple aromatic rings may contribute to its ability to interact with biological targets through π-π stacking and hydrogen bonding. Additionally, the piperazine ring can enhance the compound's pharmacokinetic properties, such as absorption and distribution. Overall, this compound's unique structural features make it a candidate for further research in drug development and therapeutic applications.
Formula:C28H29N7O
InChI:InChI=1/C28H29N7O/c1-20-4-9-24(17-26(20)34-28-31-12-10-25(33-28)23-3-2-11-30-18-23)32-27(36)22-7-5-21(6-8-22)19-35-15-13-29-14-16-35/h2-12,17-18,29H,13-16,19H2,1H3,(H,32,36)(H,31,33,34)
SMILES:Cc1ccc(cc1Nc1nccc(c2cccnc2)n1)NC(=O)c1ccc(cc1)CN1CCNCC1
Synonyms:- N-Desmethyl Imatinib
- N-Desmethyl gleevec
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
N-(4-Methyl-3-((4-(Pyridin-3-Yl)Pyrimidin-2-Yl)Amino)Phenyl)-4-(Piperazin-1-Ylmethyl)Benzamide
CAS:N-(4-Methyl-3-((4-(Pyridin-3-Yl)Pyrimidin-2-Yl)Amino)Phenyl)-4-(Piperazin-1-Ylmethyl)BenzamideFormula:C28H29N7OPurity:99%Molecular weight:479.58N-Desmethyl imatinib
CAS:N-Desmethyl imatinib (Imatinib metabolite N-Desmethyl imatinib) is a metabolite of Imatinib, which is a multi-target inhibitor of c-Kit, v-Abl, and PDGFR.Formula:C28H29N7OPurity:98.60%Color and Shape:Off-White To Pale-Yellow SolidMolecular weight:479.58Ref: TM-T11641
1mg87.00€5mg166.00€1mL*10mM (DMSO)170.00€10mg303.00€25mg512.00€50mg737.00€100mg1,018.00€Imatinib EP Impurity C (N-Desmethyl Imatinib)
CAS:Formula:C28H29N7OColor and Shape:Pale Yellow SolidMolecular weight:479.59N-Desmethyl Imatinib
CAS:Controlled ProductImpurity Imatinib EP Impurity C
Applications N-Desmethyl Imatinib (Imatinib EP Impurity C) is a metabolite of Gleevec, a tyrosine kinase inhibitor which is highly specific for BCR-ABL, the enzyme associated with chronic myelogenous leukemia (CML) and certain forms of acute lymphoblastic leukemia (ALL). It is a COVID19-related research product.
References Schindler, T., et al.: Science, 289, 1938 (2000), Drucker, B.J., et al.: N. Engl. J. Med., 344, 1031 (2001),Formula:C28H29N7OColor and Shape:NeatMolecular weight:479.58








