CAS 40632-23-3

2'-DEOXYURIDINE-5,6-D2

Description:

2'-Deoxyuridine-5,6-D2 is a deoxynucleoside, specifically a derivative of uridine where the hydroxyl group at the 2' position of the ribose sugar is replaced by a hydrogen atom, and the 5 and 6 positions of the uracil base are deuterated, meaning they contain deuterium isotopes of hydrogen. This compound is often used in biochemical and molecular biology research, particularly in studies involving nucleic acid metabolism and the synthesis of DNA. The incorporation of deuterium can help in tracing metabolic pathways and understanding the dynamics of nucleic acids in various biological systems. 2'-Deoxyuridine itself is a building block of DNA, and its isotopic variant can provide insights into the mechanisms of DNA replication and repair. The presence of deuterium can also influence the physical and chemical properties of the molecule, such as its stability and reactivity, making it a valuable tool in experimental settings.

Formula: C₉H₁₂N₂O₅

InChI: InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1/i1D,2D

InChI key: MXHRCPNRJAMMIM-AQAQJVFASA-N

SMILES: [2H]C1=C(N(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O)[2H]

Synonyms:

• 2'-DEOXYURIDINE-5,6-D2

2'-Deoxyuridine-5,6-d2

CAS: 40632-23-3, 951-78-0

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 230.22

Ref: 3U-D5352

2'-Deoxyuridine-5,6-d2

Controlled Product

CAS: 40632-23-3

Applications 2'-Deoxyuridine-5,6-d2 (CAS# 40632-23-3) is a useful isotopically labeled research compound.

Formula: C₉D₂H₁₀N₂O₅

Color and Shape: Neat

Molecular weight: 230.2143

Ref: TR-D288039