CAS 951-78-0

Deoxyuridine

Description:

Deoxyuridine is a nucleoside that plays a crucial role in the synthesis of DNA. It consists of a deoxyribose sugar molecule linked to a uracil base, which is one of the four nucleobases found in RNA, but in DNA, it is replaced by thymine. The chemical formula of deoxyuridine is C9H11N2O5, and it has a molecular weight of approximately 227.24 g/mol. Deoxyuridine is typically a white to off-white crystalline powder that is soluble in water and exhibits a slightly acidic to neutral pH in solution. It is involved in various biochemical processes, including DNA replication and repair, and serves as a substrate for the enzyme thymidine kinase, which phosphorylates it to form deoxyuridine triphosphate (dUTP). This compound is also of interest in research and therapeutic applications, particularly in the study of nucleic acid metabolism and as a potential antiviral agent. Its CAS number is 951-78-0, which uniquely identifies it in chemical databases.

Formula:C₉H₁₂N₂O₅

InChI:InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1

InChI key:InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N

SMILES:O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=CC(=O)N1

Synonyms: