CAS 4316-98-7
:6-Chloro-4,5-pyrimidinediamine
Description:
6-Chloro-4,5-pyrimidinediamine, with the CAS number 4316-98-7, is an organic compound characterized by its pyrimidine ring structure, which features two amino groups and a chlorine substituent. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the amino groups makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in the synthesis of pharmaceuticals and agrochemicals. Its chlorine atom introduces unique reactivity and can influence the compound's biological activity. 6-Chloro-4,5-pyrimidinediamine is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Safety data indicates that, like many nitrogen-containing compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound exemplifies the diverse chemistry of pyrimidine derivatives and their utility in various scientific fields.
Formula:C4H5ClN4
InChI:InChI=1S/C4H5ClN4/c5-3-2(6)4(7)9-1-8-3/h1H,6H2,(H2,7,8,9)
InChI key:InChIKey=VNSFICAUILKARD-UHFFFAOYSA-N
SMILES:NC=1C(Cl)=NC=NC1N
Synonyms:- 4,5-Diamino-6-chloropyrimidine
- 4,5-Pyrimidinediamine, 6-chloro-
- 4-Amino-6-Chloropyrimidin-5-Ylamine
- 4-Chloropyrimidine-5,6-diamine
- 5,6-Diamino-4-chloropyrimidine
- 6-Chloro-4,5-diaminopyrimidine
- 6-Chloro-4,5-pyrimidinediamine
- Ai3-52215
- Nsc 36907
- Pyrimidine, 4,5-diamino-6-chloro-
- 6-Chloropyrimidine-4,5-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Chloropyrimidine-4,5-diamine
CAS:Formula:C4H5ClN4Purity:>98.0%(GC)(T)Color and Shape:White to Amber to Dark green powder to crystalMolecular weight:144.566-Chloro-4,5-diaminopyrimidine
CAS:Formula:C4H5ClN4Purity:98%Color and Shape:SolidMolecular weight:144.5623Ref: IN-DA003N5V
1g31.00€5g79.00€10g122.00€1kgTo inquire25g200.00€250gTo inquire500gTo inquire250mg25.00€6-Chloropyrimidine-4,5-diamine
CAS:<p>6-Chloropyrimidine-4,5-diamine</p>Purity:98%Molecular weight:144.56g/mol4,5-Diamino-6-chloropyrimidine
CAS:Controlled Product<p>Applications A chlorinated diaminopyrimidine used in the preparation of various bioactive choloropurine derivatives.<br>References Suresh, M. et al.: Org. Chem. Ind. J., 6, 160 (2010);<br></p>Formula:C4H5ClN4Color and Shape:NeatMolecular weight:144.5624,5-Diamino-6-chloropyrimidine
CAS:4,5-Diamino-6-chloropyrimidine is a glycosidic compound that has been used for the optimization of drug targets. It has been shown to have antimalarial activity against Plasmodium falciparum in vitro and in vivo. 4,5-Diamino-6-chloropyrimidine binds to the amine groups on nucleotides, specifically purines (adenine and guanine), and amidates the 6-chloropurine ring. This makes it a potential candidate for use in chemotherapy. The structure of 4,5-diamino-6-chloropyrimidine was determined by NMR and mass spectroscopy analysis.Formula:C4H5ClN4Purity:Min. 95%Molecular weight:144.56 g/mol6-Chloro-4,5-diaminopyrimidine
CAS:Formula:C4H5ClN4Purity:97%Color and Shape:SolidMolecular weight:144.56





