CAS 444731-52-6: Pazopanib
Description:Pazopanib is a small molecule tyrosine kinase inhibitor primarily used in the treatment of certain types of cancer, including renal cell carcinoma and soft tissue sarcoma. Its mechanism of action involves the inhibition of multiple receptor tyrosine kinases, which play a crucial role in tumor growth and angiogenesis. Chemically, pazopanib is characterized by its complex structure, which includes a pyrimidine ring and various functional groups that contribute to its pharmacological activity. It is typically administered orally and exhibits a moderate to high bioavailability. Pazopanib is known for its side effects, which can include hypertension, diarrhea, and liver enzyme elevations, necessitating regular monitoring during treatment. The substance is classified as a targeted therapy, reflecting its specificity for cancer cells while sparing normal cells to some extent. Its development has significantly impacted cancer treatment protocols, providing an important option for patients with advanced disease. Overall, pazopanib exemplifies the advancements in targeted cancer therapies aimed at improving patient outcomes.
Formula:C21H23N7O2S
InChI:InChI=1S/C21H23N7O2S/c1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/h5-12H,1-4H3,(H2,22,29,30)(H,23,24,25)
InChI key:InChIKey=CUIHSIWYWATEQL-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C1=CC(=CC=C1C)NC2=NC=CC(=N2)N(C=3C=CC=4C(=NN(C4C)C)C3)C
- Synonyms:
- 5-({4-[(2,3-dimethyl-2H-indazol-6-yl)(methyl)amino]pyrimidin-2-yl}amino)-2-methylbenzenesulfonamide hydrochloride (1:1)
- 5-[[4-[(2,3-Dimethyl-2H-indazol-6-yl)(methyl)amino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide
- 5-[[4-[(2,3-Dimethyl-2H-indazol-6-yl)methylamino]-2-pyrimidinyl]amino]-2-methylbenzenesulfonamide
- Ae 941
- Benzenesulfonamide, 5-[[4-[(2,3-dimethyl-2H-indazol-6-yl)methylamino]-2-pyrimidinyl]amino]-2-methyl-
- Gw 786034
- Votrient
- Pazopanib
