CAS 449811-01-2: Pamapimod
Description:Pamapimod is a small molecule inhibitor primarily known for its role as a selective inhibitor of p38 mitogen-activated protein kinase (MAPK). This compound has garnered attention in the field of pharmacology due to its potential therapeutic applications, particularly in inflammatory diseases and conditions associated with excessive cytokine production. Chemically, pamapimod is characterized by its specific structure that allows it to bind to the ATP-binding site of p38 MAPK, thereby inhibiting its activity. This inhibition can lead to a reduction in the production of pro-inflammatory cytokines, making it a candidate for treating various inflammatory disorders. Pamapimod has been studied in clinical trials for conditions such as rheumatoid arthritis and other autoimmune diseases. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are crucial for determining its efficacy and safety profile in therapeutic applications. Overall, pamapimod represents a significant advancement in targeted therapy for inflammation-related conditions.
Formula:C19H20F2N4O4
InChI:InChI=1S/C19H20F2N4O4/c1-25-17-11(10-22-19(24-17)23-13(4-6-26)5-7-27)8-16(18(25)28)29-15-3-2-12(20)9-14(15)21/h2-3,8-10,13,26-27H,4-7H2,1H3,(H,22,23,24)
InChI key:InChIKey=JYYLVUFNAHSSFE-UHFFFAOYSA-N
SMILES:O=C1C(OC2=CC=C(F)C=C2F)=CC=3C=NC(=NC3N1C)NC(CCO)CCO
- Synonyms:
- 6-(2,4-Difluorophenoxy)-2-[[3-hydroxy-1-(2-hydroxyethyl)propyl]amino]-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one
- Pamapimod
- R 1503
- Ro 4402257
- Pyrido[2,3-d]pyrimidin-7(8H)-one, 6-(2,4-difluorophenoxy)-2-[[3-hydroxy-1-(2-hydroxyethyl)propyl]amino]-8-methyl-
