CAS 474012-90-3

Formula: C23H22N8O

InChI: InChI=1S/C23H22N8O/c1-12-7-4-5-10-16(12)31-21(28-15-9-6-8-13(2)17(15)22(31)32)14(3)27-20-18-19(26-11-25-18)29-23(24)30-20/h4-11,14H,1-3H3,(H4,24,25,26,27,29,30)

InChI key: PUYVJBBSBPUKBT-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)C(C)NC4=NC(=NC5=C4NC=N5)N

CAL-130 Racemate

CAS: 474012-90-3

CAL-130 Racemate is the racemate of CAL-130. CAL-130 is a PI3Kδ and PI3Kγ inhibitor (IC50s: 1.3 and 6.1 nM).

Formula: C₂₃H₂₂N₈O

Purity: 98%

Color and Shape: Solid

Molecular weight: 426.47

Ref: TM-T10660L2

CAL-130 Racemate

CAS: 474012-90-3

Formula: C₂₃H₂₂N₈O

Molecular weight: 426.4738

Ref: IN-DA00DB5A

2-[1-[(2-Amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one

CAS: 474012-90-3

2-[1-[(2-Amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one is a synthetic pharmaceutical compound, classified as a small molecule inhibitor. It is derived from a combination of purine and quinazoline structures, typically synthesized through multi-step organic processes. This compound exhibits its mode of action by specifically targeting and inhibiting certain key enzymes or receptors within cellular pathways, potentially interfering with aberrant signaling processes. Through this mechanism, it can modulate biological activity, offering a pathway to correct dysregulated cellular environments.

Formula: C₂₃H₂₂N₈O

Purity: Min. 95%

Molecular weight: 426.5 g/mol

Ref: 3D-ZTA01290