CAS 477-85-0

Obtusifolin

Description:

Obtusifolin, with the CAS number 477-85-0, is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the Apocynaceae family. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Obtusifolin exhibits a range of pharmacological properties, including anti-inflammatory, analgesic, and potential anticancer effects, making it a subject of interest in medicinal chemistry. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. The compound's interactions with biological systems are often mediated through its ability to bind to specific receptors or enzymes, highlighting its potential therapeutic applications. As research continues, the exploration of obtusifolin's mechanisms of action and its efficacy in various biological contexts remains a key area of study in natural product chemistry and pharmacology.

Formula: C₁₆H₁₂O₅

InChI: InChI=1S/C16H12O5/c1-7-6-9-12(16(21-2)13(7)18)15(20)11-8(14(9)19)4-3-5-10(11)17/h3-6,17-18H,1-2H3

InChI key: InChIKey=NYRXUBDGDSRBGB-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(=O)C=3C(C2=O)=C(O)C=CC3)=CC(C)=C1O

Synonyms:

• 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthracenedione
• 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthraquinone
• 9,10-Anthracenedione, 2,8-dihydroxy-1-methoxy-3-methyl-
• Anthraquinone, 2,8-dihydroxy-1-methoxy-3-methyl-
• Obtusifolin
• Obtusifolin (anthraquinone)
• Obtusifoline
• 2,8-Dihydroxy-1-Methoxy-3-Methylanthraquinone
• 2,8-dihydroxy-1-methoxy-3-methylanthracene-9,10-dione
• Obtusifolin ISO 9001：2015 REACH

Obtusifolin

CAS: 477-85-0

Formula: C₁₆H₁₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 284.2635

Ref: IN-DA00DGQV

Obtusifolin

CAS: 477-85-0

Obtusifolin

Purity: ≥98%

Molecular weight: 284.26g/mol

Ref: 54-BUP04333

Obtusifolin

CAS: 477-85-0

Formula: C₁₆H₁₂O₅

Molecular weight: 284.27

Ref: 7W-GY8146

Obtusifolin

CAS: 477-85-0

Formula: C₁₆H₁₂O₅

Purity: 95%~99%

Molecular weight: 284.267

Ref: BP-BP1020

Obtusifolin

CAS: 477-85-0

Obtusifolin is an antioxidant that combats diabetes, bone-resorption, diabetic retinopathy, pain, and cognitive decline.

Formula: C₁₆H₁₂O₅

Purity: 99.78% - 99.99%

Color and Shape: Solid

Molecular weight: 284.26

Ref: TM-T4S0969

Obtusifolin

CAS: 477-85-0

Quinone

Formula: C₁₆H₁₂O₅

Purity: ≥ 95.0 % (HPLC)

Molecular weight: 284.26

Ref: 5G-83880

Obtusifolin

CAS: 477-85-0

Obtusifolin is a natural compound, which is a bioactive anthraquinone derivative extracted from the seeds of Cassia obtusifolia, a plant known for its medicinal properties. With its unique molecular structure, Obtusifolin exhibits significant anti-inflammatory and antioxidant activities. These properties are primarily due to its ability to modulate various biochemical pathways, including the inhibition of pro-inflammatory cytokines and the scavenging of reactive oxygen species.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Molecular weight: 284.26 g/mol

Ref: 3D-XO171108